2. Calculate the potential of a silver indicator electrode versus the standard calomel electrode after the addition of 5.00, 15.00, 25.00, 30.00, 35.00, 39.00, 39.50, 39.60, 39.70, 39.80, 39.90, 39.95, 39.99, 40.00, 40.01, 40.05, 40.10, 40.20, 40.30, 40.40, 40.50, 41.00, 45.00, 50.00, 55.00 mL, and 70.00 of 0.1000 M AgNO3 to 50.00 mL of 0.0800 M KSeCN. Construct a titra- tion curve and a first- and second-derivative plot from these data. (Ksp for AgSeCN = 4.20 × 10-16.)

2. Calculate the potential of a silver indicator electrode versus the standard calomel electrode after the addition of 5.00, 15.00, 25.00, 30.00, 35.00, 39.00, 39.50, 39.60, 39.70, 39.80, 39.90, 39.95, 39.99, 40.00, 40.01, 40.05, 40.10, 40.20, 40.30, 40.40, 40.50, 41.00, 45.00, 50.00, 55.00 mL, and 70.00 of 0.1000 M AgNO3 to 50.00 mL of 0.0800 M KSeCN. Construct a titra- tion curve and a first- and second-derivative plot from these data. (Ksp for AgSeCN = 4.20 × 10-16.)

Fundamentals Of Analytical Chemistry

9th Edition

ISBN:9781285640686

Author:Skoog

Publisher:Skoog

Chapter21: Potentiometry

Section: Chapter Questions

Problem 21.23QAP

See similar textbooks

Similar questions

For each of the following reactions, determine the overall balanced electrochemical reaction, its standard electric potential, and the standard Gibbs energy of the reaction. aCo+F2Co2++2F bZn+Fe2+Zn2++Fe c Zn+Fe3+Zn2++Fe d Hg2++HgHg22+
Calculate the electrode potentials for the following systems: (a) Cr2O72-(5.00 10-3 M),Cr3+(2.50 10-2 M),H+ (0.100 M)|Pt (b) UO22+(0.100 M),U4+ (0.200 M),H+ (0.600 M)|Pt
At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)
What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)