3. Draw compounds A-G in the space below the scheme using line notationΟΞA: hexanoic acidB: 1-heptyneSOCI₂HgSO4, H2SO4H₂OEC(CH3)2CuLiMgBrFNaOCl, HOAcD1. CH3CHO2. H₂OtGHCN1. 032. Me₂S(acetone is a by product of thereaction from E to D)1. PhMgBr2. H₂OH

Answered: Image /qna-images/answer/9dc4df14-1011-4ba8-8d35-d45b4667a738.jpg

Answered: 3. Draw compounds A-G in the space…

Organic Chemistry

9th Edition

ISBN:9781305080485

Author:John E. McMurry

Publisher:John E. McMurry

Chapter20: Carboxylic Acids And Nitriles

Section20.SE: Something Extra

Problem 37AP

See similar textbooks

Similar questions

The key step in a reported laboratory synthesis of sativene, a hydrocarbon isolated from the mold Helminthosporium sativum, involves the following base treatment of a keto tosylate. What kind of reaction is occurring? How would you complete the synthesis?
Complete each acid-base reaction and predict whether the position of equilibrium lies toward the left or toward the right. (a) CH3CCH+CH3CH2ONa+CH3CH3OH (b) CH3CCCH2CH2OH+Na+NH2NH3(l)
Which is true regarding the direction of the following reaction? CH3COOH (aq) + H2PO-4 <<>>> CH3COO- + H3PO4 a) the reaction favors the reactant side b) the reaction favors the product side c) the reaction favors both reactants and products equally d) the table of acidity does not proviede enough information to answer this question
Give a clear explanation (step-wise) for the question below
Which of the following substituted phenol is the strong acid? |- p-nitrophenol Il-p-methoxyphenol III- p-ethylphenol IV- p-methylphenol * II IV All have the same acidity
C. Arrange the following compounds in order of decreasing reactivity towards hydrolysis. H2N, M,co H3CO NAI IYK КАН BCS D. Arrange the following chemical species in order of decreasing basicity. OH он CH3 `CH3 ARL ENE YAS MIN
3. Draw the structure(s) of the major organic product(s), for each of the following reactions. ELOH cat. H,SO, Br 1) 2 eq. Li b) 2) PHCHO 3) NH,C(ag) Ph = Phenyl 2 oq. Li c) NH,(1) 1) Hg(O,CCF3)z, (CH,);COH d) 2) NABH,, NAOH cat. NMO CH;C),
-3) Arrange each of the following in increasing order of acidity. COOH COOH TO H COOH CH3 of their bocie strongth
57. Arrange the compounds shown in decreasing (strongest to weakest) order of basicity. NH₂ NH₂ CF3 1 NH₂ OCH3 11 E ||| NH₂ IV
Regarding to the following compounds: NH3, H2O, H2SA) Rank the following compounds in order of increasing acidityB) Mention their conjugate bases and rank according to increasing their basicity order
Draw the structure(s) of the major organic product(s), for each of the following reactions. ELOH a) cat. H,SO4 Br 1) 2 eq. Li b) 2) PHCHO 3) NH,Cl(aq) Ph = Phenyl 2 eq. Li c) NH3(1) 1) Hg(0,CCF,)2, (CH,),COH d) 2) NaBH4, NAOH Os04 e) cat. NMO OH PB13 f) CH,Cl,
1. Which acid is stronger in each set? (a) (c) HCI or LOH or OH₂ (b) ~ or (CH3)2NH

SEE MORE QUESTIONS

Recommended textbooks for you

Organic Chemistry

Chemistry

ISBN:

9781305080485

Author:

John E. McMurry

Publisher:

Cengage Learning

Organic Chemistry

Chemistry

ISBN:

9781305580350

Author:

William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Publisher:

Cengage Learning

Organic Chemistry

Chemistry

ISBN:

9781305080485

Author:

John E. McMurry

Publisher:

Cengage Learning

Organic Chemistry

Chemistry

ISBN:

9781305580350

Author:

William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Publisher:

Cengage Learning

SEE MORE TEXTBOOKS

3. Draw compounds A-G in the space below the scheme using line notation ΟΞ A: hexanoic acid B: 1-heptyne SOCI₂ HgSO4, H2SO4 H₂O E C (CH3)2CuLi MgBr F NaOCl, HOAc D 1. CH3CHO 2. H₂Ot G HCN 1. 03 2. Me₂S (acetone is a by product of the reaction from E to D) 1. PhMgBr 2. H₂O H