3. Metal ion complexation is known to affect the half-wave potential for the reduction ofa metal ion.M+ + Hg+ne → M(Hg)MxAMAX (n-x)+[1][2]The relationship between the molar concentrations of the ligand CL and the shift in thehalf-wave potential is:=(E) E (-0.0592/n)logK - (0.0592x/n)logcL[3]Where (E) and E½ are half-wave potentials for the complexed and uncomplexedcation, respectively, K, is the formation constant for the complex, and x is the molarcombining ratio of the complexing agent to cation.The following polarographic data were obtained for the reduction of Pb2+ to itsamalgam from solutions that were 2.00 x 10-3 M in Pb2+, 0.100 M in KNO3, anddifferent concentrations of the anion A. From the half-wave potentials, find (i) theformula of the complex, and (ii) its formation constant Kſ.Concentration A, M0.0000E vs. SCE, V-0.4050.0200-0.4730.0600-0.5070.1007-0.5160.3000-0.5470.5000-0.558

To solve this problem, we will use the given polarographic data and the provided relationship…

3. Metal ion complexation is known to affect the half-wave potential for the reduction of a metal ion. M++Hg+ne → M(Hg) MxAMAX (n-x)+ [1] [2] The relationship between the molar concentrations of the ligand CL and the shift in the half-wave potential is: = (E) E (-0.0592/n)logK - (0.0592x/n)logcL - [3] Where (E) and E½ are half-wave potentials for the complexed and uncomplexed

3. Metal ion complexation is known to affect the half-wave potential for the reduction of a metal ion. M++Hg+ne → M(Hg) MxAMAX (n-x)+ [1] [2] The relationship between the molar concentrations of the ligand CL and the shift in the half-wave potential is: = (E) E (-0.0592/n)logK - (0.0592x/n)logcL - [3] Where (E) and E½ are half-wave potentials for the complexed and uncomplexed

Chemistry & Chemical Reactivity

10th Edition

ISBN:9781337399074

Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Publisher:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Chapter22: The Chemistry Of The Transistion Elements

Section: Chapter Questions

Problem 82GQ: The transition metals form a class of compounds called metal carbonyls, an example of which is the...

See similar textbooks

Similar questions

The transition metals form a class of compounds called metal carbonyls, an example of which is the tetrahedral complex Ni(CO)4. Given the following thermodynamic data (at 298 K): (a) Calculate the equilibrium constant for the formation of Ni(CO)4(g) from nickel metal and CO gas. (b) Is the reaction of Ni(s) and CO(g) product- or reactant-favored at equilibrium? (c) Is the reaction more or less product-favored at higher temperatures? How could this reaction be used in the purification of nickel metal?
Use the formation constant of [Au(CN)2] in Appendix K to determine the equilibrium concentration of Au+(aq) in a solution that is 0.0071 M CN and 1.1 104 M [Au(CN)2]. Is it reasonable to conclude that 100% of the gold in solution is present as the [Au(CN)2] complex ion? Explain.
Calculate the standard potential for the half-reaction Al (C2O4)2- + 3e- Al(s ) + 2C2O42- if the formation constant for the complex is 1.3 1013.
Predict whether the carbonate ligand CO32- will coordinate to a metal center as a monodentate, bidentate, or tridentate ligand.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
An aqueous solution of an unknown salt of vanadium is electrolyzed by a current of 2.50 amps for 1.90 hours. The electroplating is carried out with an efficiency of 95.0%, resulting in a deposit of 2.850 g of vanadium. a How many faradays are required to deposit the vanadium? b What is the charge on the vanadium ions (based on your calculations)?
Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
Four different octahedral chromium coordination compounds exist that all have the same oxidation state for chromium and have H2O and Cl as the ligands and counterions. When 1 mole of each of the four compounds is dissolved in water, how many moles of silver chloride will precipitate upon addition of excess AgNO3?
The following reactions all occur in a blast furnace. Which of these are redox reactions? (a) 3Fe2O3(s)+CO(g)2Fe3O4(s)+CO2(g) (b) Fe3O4(s)+CO(g)3FeO(s)+CO2(g) (c) FeO(s)+CO(g)Fe(l)+CO2(g) (d) C(s)+O2(g)CO2(g) (e) C(s)+CO2(g)2CO(g) (f) CaCO3(s)CaO(s)+CO2(g) (g) CaO(s)+SiO2(s)CaSiO3(l)
One of the following nitrogen compounds or ions is not capable of serving as a ligand: NH4+, NH3, NH2. Identify this species, and explain your answer.