A bomb calorimeter, or a constant volume calorimeter, is a device often used to determine the heat of combustion of fuels and the energy content of foods. In an experiment, a 0.6770 g sample of quinizarin (C14H3O4) is burnmed completely in a bomb calorimeter. The calorimeter is surrounded by 1.304x10° g of water. During the combustion the temperature increases from 25.97 to 28.55 °C. The heat capacity of water is 4.184 J gl°c!. The heat capacity of the calorimeter was determined in a previous experiment to be 893.2 J°C. Assuming that no energy is lost to the surroundings, calculate the molar heat of combustion of quinizarin based on these data. C1,H3O4(s) + 1402(g)→ 4 H,O(1) + 14 CO2(g) + Energy Molar Heat of Combustion = kJ/mol

A bomb calorimeter, or a constant volume calorimeter, is a device often used to determine the heat of combustion of fuels and the energy content of foods. In an experiment, a 0.6770 g sample of quinizarin (C14H3O4) is burnmed completely in a bomb calorimeter. The calorimeter is surrounded by 1.304x10° g of water. During the combustion the temperature increases from 25.97 to 28.55 °C. The heat capacity of water is 4.184 J gl°c!. The heat capacity of the calorimeter was determined in a previous experiment to be 893.2 J°C. Assuming that no energy is lost to the surroundings, calculate the molar heat of combustion of quinizarin based on these data. C1,H3O4(s) + 1402(g)→ 4 H,O(1) + 14 CO2(g) + Energy Molar Heat of Combustion = kJ/mol

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter6: Thermochemistry

Section: Chapter Questions

Problem 112AE: In a bomb calorimeter, the reaction vessel is surrounded by water that must be added for each...

See similar textbooks

Similar questions

A sample of sucrose, C12H22O11, is contaminated by sodium chloride. When the contaminated sample is burned in a bomb calorimeter, sodium chloride does not burn. What is the percentage of sucrose in the sample if a temperature increase of 1.67C is observed when 3.000 g of the sample are burned in the calorimeter? Sucrose gives off 5.64103kJ/mol when burned. The heat capacity of the calorimeter and water is 22.51 kJ/C.
Salicylic acid, C7H6O3, is one of the starting materials in the manufacture of aspirin. When 1.00 g of salicylic acid burns in a bomb calorimeter, the temperature of the bomb and water goes from 23.11C to 28.91C. The calorimeter and water absorb 21.9 kJ of heat. How much heat is given off when one mole of salicylic acid burns?
A 0.470-g sample of magnesium reacts with 200 g dilute HCl in a coffee-cup calorimeter to form MgCl2(aq) and H2(g). The temperature increases by 10.9 C as the magnesium reacts. Assume that the mixture has the same specific heat as water and a mass of 200 g. (a) Calculate the enthalpy change for the reaction. Is the process exothermic or endothermic? (b) Write the chemical equation and evaluate H.
When solid iron burns in oxygen gas (at constant pressure) to produce Fe2O3(s), 1651 kJ of heat is released for every 4 mol of iron burned. How much heat is released when 10.3 g Fe2O3(s) is produced (at constant pressure)? What additional information would you need to calculate the heat released to produce this much Fe2O3(s) if you burned iron in ozone gas, O3(g), instead of O2(g)?
9.41 Under what conditions does the enthalpy change equal the heat of a process?
A 50-mL solution of a dilute AgNO3 solution is added to 100 mL of a base solution in a coffee-cup calorimeter. As Ag2O(s) precipitates, the temperature of the solution increases from 23.78 C to 25.19 C. Assuming that the mixture has the same specific heat as water and a mass of 150 g, calculate the heat q. Is the precipitation reaction exothermic or endothermic?
Give the definition of the standard enthalpy of formation for a substance. Write separate reactions for the formation of NaCl, H2O , C6H12O6, and PbSO4 that have H values equal to Hf for each compound.
When 2.50 g of methane burns in oxygen, 125 kJ of heat is produced. What is the enthalpy of combustion per mole of methane under these conditions?
Given the following (hypothetical) thermochemical equations: A+B2C;H=447kJA+3D2E;H=484kJ2D+B2F;H=429kJ Calculate H, in kJ, for the equation 4E+5B4C+6F
Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.
Ammonium nitrate is an oxidizing agent and can give rise to explosive mixtures. A mixture of 2.00 mol of powdered aluminum and 3.00 mol of ammonium nitrate crystals reacts exothermically yielding nitrogen gas, water vapor, and aluminum oxide. How many grams of the mixture are required to provide 245 kJ of heat? See Appendix C for data.
In a bomb calorimeter, the reaction vessel is surrounded by water that must be added for each experiment. Since the amount of water is not constant from experiment to experiment, the mass of water must be measured in each case. The heat capacity of the calorimeter is broken down into two parts: the water and the calorimeter components. If a calorimeter contains 1.00 kg water and has a total heat capacity of 10.84 kJ/C, what is the heat capacity of the calorimeter components?