Analyze the reactant(s) and reaction conditions, then predict the structure of the major organic product and indicate the predominant mechanism (SN1, SN2, E1, or E2) of each reaction. CH₂CH₂CH₂CH₂ Br CH₂CH₂CH₂CH₂Br Cl CHI + NaNO₂ KOC(CH3)3 (CH3)3COH, 82° C ee Na OCH3 CH,OH, 0° C Na SCH₂CH₂ DMF, 0º C 5° C

Analyze the reactant(s) and reaction conditions, then predict the structure of the major organic product and indicate the predominant mechanism (SN1, SN2, E1, or E2) of each reaction. CH₂CH₂CH₂CH₂ Br CH₂CH₂CH₂CH₂Br Cl CHI + NaNO₂ KOC(CH3)3 (CH3)3COH, 82° C ee Na OCH3 CH,OH, 0° C Na SCH₂CH₂ DMF, 0º C 5° C

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

Which reactions have a positive ASrxn? 2 A(g) + 3 B(g) →→→ 4 C(g) A(s) + B(s) C(g) 2 A(g) + 2 B(g) →→→ 5 C(g) → C(g) A(s) + 2 B(g) -
For the following reactions at constant pressure, predict if ΔΗ>ΔΕ, ΔΗ ΔΕ Ο ΔΗ ΔΕ Ο ΔΗ= ΔΕ %3D c. 2NΟ (g)+ 0, (9) - 2ΝΟ (g) ΟΔΗ ΔΕ ΟΔΗ ΔΕ
5. Target Reaction: 20 H O(1) + 2H 0) 2C H O) + O_() 2 4 Step Reactions: 2 C2H601) + 302(g) → 2CO2(g) + 3H2OO C2H40(1) + 5/202(g) → 2CO2(g) + 2H2O(1) AH = -685 kJ AH = -583.5 k-
If the pressure is increased for each reaction shown below, select the total number of reactions that will form more products:N2(g)+O2(g)↔2NO(g)2NO2(g)↔2NO(g)+O2(g)N2O4(g)↔2NO2(g)CaCO3(s)↔CaO(s)+CO2(g)CO2(g)+H2O(l)↔H2CO3(aq)2CO(g)↔C(s)+CO2(g) a. 3 b.1 c. 0 d. 2 e. 4
Isopentyl alcohol reacts with pure acetic acid to form isopentyl acetate, the essence of banana oil:C₅H₁₁OH+CH₃COOH⇌CH₃COOC₅H₁₁+H₂O A student adds a drying agent to remove H₂O and thus increase the yield of banana oil. Is this approach reasonable? Explain
Reaction 1: CO(g)+3H2(g)⇄CH4(g)+H2O(g)CO(g)+3H2(g)⇄CH4(g)+H2O(g) K1=[CH4][H2O][CO][H2]3K1=[CH4][H2O][CO][H2]3 Reaction 2: CO2(g)+H2(g)⇄CO(g)+H2O(g)CO2(g)+H2(g)⇄CO(g)+H2O(g) K2=[CO][H2O][CO2][H2]K2=[CO][H2O][CO2][H2] Reaction 3: CH4(g)+2H2O(g)⇄CO2(g)+4H2(g)CH4(g)+2H2O(g)⇄CO2(g)+4H2(g) K3=?K3=? The chemical equations and equilibrium expressions for two reactions at the same temperature are given above. Based on the information, which of the following expressions can be used to calculate the value of K3K3 for reaction 3 at the same temperature? A
N2 and O2 are mixed in a flask and react (according to the equation below). Once the rxn achieved equilibrium [NO]eq = 1.8 mM, [O2]eq = 1.2 mM and [NO2]eq = 780 mM. What is the Kc value at this temperature? Identify whether the reaction is product favored or reactant favored at equilibrium. N2(g) + O2(g)⟷⟷ 2NO(g) A)Rxn is product favored at equilibrium B)Kc = 2.8 x 10-6 C)Rxn is reactant favored at equilibrium D)Kc = 3.6 x 105 E)Kc = 6.3 x 10-9 F)Kc = 1.6 x 108
1) Use Hess's Law to determine AH for the following target reaction. 3 CO₂(g) + 4 H₂O(g) b) C3Hg(g) + 5 O₂(g) C(s) + O₂(g) -CO₂(g) 2 H₂(g) + O₂(g) 3 C(s) + 4 H₂(g) →→→ 2 H₂O(g) C3H8(g) AH = AH = ΔΗ ΔΗ = ??? -2043 kJ -393.5 kJ -483.6 kJ
For which of the following reactions would you predict AH,xn° 0? O N2(g) + 3 H2(g) 2 NH3(g) 1> O3(8) O2(g) + O(g) O H20(1) H20(g) O Pb2+(aq) + SO42-(aq) - PBSO4(s) O5 C(s) + 4 KNO3(s) 5 CO2(g) + 2 N2(g) + 2 K20(s)
1 q q Calculate AH for the reaction N₂(g) + O₂(g) →→ 2NO(g) Given the following hypothetical data: N₂(g) +202 (g) → 2NO₂ (g) 2NO(g) + O₂(g) → 2NO₂ (g) kJ AH = Submit Answer Retry Entire Group [Review Topics] AH = 68 kJ AH = -112 kJ 9 more group attempts remaining [References]
owing gas-pr reactions. Average Bond Enthalpies (kJ/mol) Single Bonds C-H C-C C-N C-O C-F C-Cl C-Br C-I C-S C1–C1 Br-Br 413 N-H 348 N-N 293 N-O 358 |N-F 485 N-C1 328 N-Br 276 240 H-H 259 H-F H-Cl H-Br H-I 242 193 Multiple Bonds C=C C=C C=N C=N C=O C=O 391 O-H 163 0-0 201 O-F 272 O-Cl 200 O-I 243 S-H 436 S-F 567 S-Cl 431 S-Br 366 S-S 299 614 |N=N 418 839 |N=N 941 615 |N=O 607 891 799 1072 463 146 190 203 234 339 327 253 218 266 0=0 495
Determine the AH of the reaction 1 1 NO29) + 702c9) +5H20(9) → HNO3(aq) 4 AH = 33.2 kJ 5 N2c9) + O2cg) → N02c9) 1 Haa) +Nzo) +0zc) → HNO3(aq) AH = -202.3 kJ 1 H2(g) - ΗΝO3(αq) 1 H2(g) * 2 → H20(g) AH = -285.8 kJ