Question 6Cobalt(II,III) oxide can be reduced to form elemental cobalt through thereaction:C03O4(s) → 3 Co(s) + 2 O2(g)Calculate AHO for the above reaction given the following (all values are at 25°C):(i) 3 CoO(s) + ½ O₂(g) → C03O4(s)(ii) Co(s) + ½ O₂(g) → CoO(s)kJΔΗ°ΔΗ°= -177.5 kJ= -237.9 kJ

Since,According to Hess's law change of enthalpy in a chemical reaction is same regardless of…

Cobalt(II,III) oxide can be reduced to form elemental cobalt through the reaction: Co3O4(s) 3 Co(s) + 2 O2(g) Calculate AH° for the above reaction given the following (all values are at 25°C): ΔΗ° = -177.5 kJ (i) 3 COO(s) + 1/2O2(g) → Co3O4(s) (ii) Co(s) + 2 O2(g) → CoO(s) AHⓇ = -237.9 kJ kJ

Cobalt(II,III) oxide can be reduced to form elemental cobalt through the reaction: Co3O4(s) 3 Co(s) + 2 O2(g) Calculate AH° for the above reaction given the following (all values are at 25°C): ΔΗ° = -177.5 kJ (i) 3 COO(s) + 1/2O2(g) → Co3O4(s) (ii) Co(s) + 2 O2(g) → CoO(s) AHⓇ = -237.9 kJ kJ

Living By Chemistry: First Edition Textbook

1st Edition

ISBN:9781559539418

Author:Angelica Stacy

Publisher:Angelica Stacy

ChapterU6: Showtime: Reversible Reactions And Chemical Equilibrium

SectionU6.2: How Backward: Reversible Reactions

Problem 7E

See similar textbooks

Similar questions

The space shuttle Orbiter utilizes the oxidation of methylhydrazine by dinitrogen tetroxide for propulsion: 4N2H3CH3(l)+5N2O4(l)12H2O(g)+9N2(g)+4CO2(g) Calculate H for this reaction
When lightning strikes, the energy can force atmospheric nitrogen and oxygen to react to make NO: N2(g)+O2(g)2NO(g)H=+181.8kJ (a) Is this reaction endothermic or exothermic? (b) What quantities of reactants and products are assumed if H = +181.8 kJ? (c) What is the enthalpy change when 3.50 g nitrogen is reacted with excess O2(g)?
What is Hrxn for reaction of iron(III) oxide and carbon monoxide to give iron metal and carbon dioxide gas? Use the following reactions: 4Fe(s)+3O2(g)2Fe2O3(s)H=1648.4kJ4CO(g)+O2(g)2CO3(g)H=565.98kJ
Write a balanced chemical equation for the formation of CaCO3(s) from the elements in their standard states. Find the value for rH for CaCO3(s) in Appendix L.
Chlorine dioxide, ClO2, is a reddish yellow gas used in bleaching paper pulp. The average speed of a ClO2 molecule at 25C is 306 m/s. What is the kinetic energy (in joules) of a ClO2 molecule moving at this speed?
Calculate H for each of the following reactions, which occur in the atmosphere. a. C2H4(g) + O3(g) CH3CHO(g) + O2(g) b. O3(g) + NO(g) NO2(g) + O2(g) c. SO3(g) + H2O(l) H2SO4(aq) d. 2NO(g) + O2(g) 2SO2(g)
A reaction used to produce the silicon for semiconductors from sand (SiO2), can be broken up into three steps: SiO2(s)+2C(s)Si(s)+2CO(g)H=689.9kJ Si(s)+2Cl2(s)SiCl4(g)H=657.0kJ SiCl4(g)+2Mg(s)2MgCl2(g)+Si(s)H=625.6kJ (a) Write a thermochemical equation for the overall reaction where silicon is obtained from silicon dioxide and CO and MgCl2 are by-products. (b) What is H for the formation of one mole of silicon? (c) Is the overall reaction exothermic?
Given: 2MNO(s) + O2(g) → 2MnO2(s) ArH = –269.6 kJ · mol-1
The reaction is as follows: 2 CO(g) + O2(g)—> 2 CO2(g)
Enter your answer in the provided box. Calculate AG for the following reaction at 25°C: 3Sr²+ (aq) + 2Al(s) AGº =411.03 x mol 3Sr(s) + 2A1³+ (aq)
Write the balanced NET ionic equation for the reaction when aqueous BaCl2 and aqueous (NH4)2SO, are mixed in solution to form aqueous NH,CI and solid BaSO4. O4- 3. 2. 2+ 3+ 4+ 1 2. 3 4 6. 7 8. 9. 4 7 8. 69 1. (s) (1) (g) (aq) Ba CI Reset • x H2O Delete SI 5.
Consider the following reaction. (a) Is the reaction exothermic or endothermic? exothermic endothermic CH3OH(g) → CO(g) + 2 H₂(g) AH +90.7 kJ (b) Calculate the amount of heat transferred when 35.0 g of CH3OH(g) are decomposed by this reaction at constant pressure. ΔΗ= 100.8 (c) If the enthalpy change is 19.0 kJ, how many grams of hydrogen gas are produced? 0.42 x g (d) How many kilojoules of heat are released when 13.0 g of CO(g) reacts completely with H₂(g) to form CH₂OH(g) at constant pressure? AH = -90.7 X kJ (e) Calculate AE when 400.0 g of CH3OH(g) completely reacts at a constant temperature of 300 K and constant pressure of 0.95 atm. R = 8.314 J/mol*K and R = 0.08206 atm*L/mol K-41.7 XkJ HopHelpCh5N1