For the reaction CO(g) + Cl2(g)=COCI2(g) Kc = 255 at 1000 K. A reaction mixture initially contains a CO concentration of 0.1510 M and a Cl2 concentration of 0.176 M at 1000 K. What is the equilibrium concentration of COC12 at 1000 K ?

For the reaction CO(g) + Cl2(g)=COCI2(g) Kc = 255 at 1000 K. A reaction mixture initially contains a CO concentration of 0.1510 M and a Cl2 concentration of 0.176 M at 1000 K. What is the equilibrium concentration of COC12 at 1000 K ?

Chemistry & Chemical Reactivity

9th Edition

ISBN:9781133949640

Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Publisher:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Chapter15: Principles Of Chemical Reactivity: Equilibria

Section15.4: Using Equilibrium Constants In Calculations

Problem 1RC: 1. Graphite and carbon dioxide are kept at constant volume at 1000 K until the reaction C(graphite)...

See similar textbooks

Related questions

Q: How many compounds, of the ones listed below, have hydrogen bonding? CH3(CH2)2NH2…

A: Step 1:Condition for Hydrogen bonding When hydrogen is joined to an atom that is extremely…

Q: None

A: Approach to solving the question:Please see attached photos for detailed solutions. thank you.…

Q: Help me answer the following question, explain and make sure everything is correct, thank you !

A: Approach to solving the question: Detailed explanation:

Q: A chemist fills a reaction vessel with 0.772 atm nitrogen (N2) gas, 5.76 atm hydrogen (H2) gas, and…

A: Approach to solving the question: Detailed explanation: Examples: Key references:

Q: 2. Changes in which factors affect both the rate and the rate constant of a first order reaction? I…

A: The objective of the question is to identify the factors that affect both the rate and the rate…

Q: Draw the structure(s) of the major organic product(s) of the following reaction. Br - N₂ Br Br CH3 +…

A: Approach to solving the question: Detailed explanation: Examples: Key references:

Q: show how to synthesize the molecule at the right, starting with the molecule on the left plus any…

Q: What is the enthalpy change when 49.4mL of .430 M sulfuric acid reacts with 23.3 mL of .309 M…

A: The objective of this question is to calculate the enthalpy change when sulfuric acid reacts with…

Q: Draw the starting monomeric structure that would lead to th addition polymer. Drawing PhC(O)OOC(O)Ph…

A: Step 1:Step 2:

Q: How many moles of methane must be burned to generate the energy produced by fission of 0.560 molmol…

A: A typical fission reaction of uranium -235 is: 23592 U + 10 n → 13957 La + 9542 Mo + 210 n +…

Q: 4Fe + 3O2 -> 2Fe2O3 How many moles of oxygen reacts with 2.4 moles of iron in the rusting…

A: Given: Moles of Fe = 2.4 mol (2 significant figures) Plan to…

Q: 1) Given that volume change of mixing A and B is AVM = 8.4XXB (cc/mol)— a. Calculate and tabulate,…

A: The objective of the question is to calculate and tabulate the volume change of mixing A and B (AVM)…

Q: Calculate the mass percent (m/m) of a solution prepared by dissolving 57.95 g of NaCl in 171.5 g of…

A: The objective of this question is to calculate the mass percent of a solution. The mass percent is…

Q: In which pair of compounds should the first member be more covalent than the second member? OTICI 3,…

A: The objective of the question is to identify the pair of compounds in which the first member is more…

Q: Balance the reaction between Fe and HNO3 to form Fe2+ and NO in acidic solution. When you have…

A: Given equation is as followsFe (iron metal) + HNO3 (nitric acid) --> Fe2+ (iron ion) + NO (nitric…

Q: Need help with chemistry question

Q: help q17

Q: None

A: Calculating Ecell with Non-Standard Concentrations (Step-by-Step)The scenario presented involves an…

Q: Use Boyle's, Charles's, or Gay-Lussac's law to calculate the missing value in each of the following.…

A: (a) Given, V1=2.0 LV2=1 LP1=0.79 atm We can find P2 by using the formula of Boyle's law.…

Q: 2 Draw a Lewis structure for each of the following compounds of electrons. a) CH3F b) CO32- c) SO42-…

A: a) CH3F=4+(1x3)+7=14 Electronsb. CO32-=4+(6x3)+2(from the ionic charge) = 24c. SO42-=6+(6*4)+2= 324.…

Q: Calculate the entropy of the following dissociation reaction. Cu(NO3)2(s) -> Cu2+ (aq) + 2…

A: The objective of this question is to calculate the entropy change for the given dissociation…

Q: Calculate the concentration of each solution in mass percent. 166 mg C6H12O6 in 4.71 g H2O

A: The objective of the question is to calculate the concentration of the solution in mass percent. The…

Q: Rank the following elements according to their ionization energy. element ionization energy rubidium…

A: The ranking from highest to lowest ionization energy would be:1. Magnesium2. Calcium3. Potassium4.…

Q: 1.3. Give possible products for the reactions of M-hydride elimination and Ferrocene reactions (a)…

A: Certainly! Let's go through the potential products for each of these reactions:M-Hydride…

Q: The label on a bottle of medicine reads "Each 5 mL teaspoonful contains glucose, 1.87 g;…

A: The objective of the question is to find the amount of phosphoric acid in a given dosage of medicine…

Q: The graph below shows the reaction coordinate diagram for a reaction in the presence and absence of…

A: 1:From the energy profile diagram, in absence of catalyst activation energy is higher. Activation…

Q: Draw the following molecule with the correct formal charges on all functional groups at pH 2 and pH…

A: Step 1:At pH = 2 At pH = 7.4

Q: In Cannizzaro's reaction, the intermediate that will be the best hydride donor is (A) (C) (B) H OH H…

A: In Cannizzaro's reaction, an aldehyde is disproportionated (simultaneously oxidized and reduced) in…

Q: Which of the following is the correct ground state electron configuration for Cr3⁺?…

A: The electronic configuration of Cr in ground state is: Cr=1s22s22p63s23p63d54s1Or Cr=[Ar]3d⁵4s¹ The…

Q: A 15.0 mL of 0.500 M Ba(OH)2 is required to titrate a 10.0 mL of an unknown solution of HNO3,…

A: Thank you.

Q: None

A: The objective of the question is to calculate the standard enthalpy change (ΔH°) for the given…

Q: (a) Is the cyclopropenyl cation aromatic or anti - aromatic? (circle one) (b) Is the…

A: Here, in case of cyclopentadienyl anion, according to huckle rule, we are getting value 1, which…

Q: help q15

A: Step 1:The given cyclic monosaccharide is, Step 2:In the cyclic form, the carbon atom attached to…

Q: dont providehandwritng solution.....

Q: Please help with this last question, try to provide pics for the step. Thumbs up will be given,…

A: The objective of the question is to propose a synthesis of 3-buten-2-one using acetoacetic ester…

Q: Under identical conditions, separate samples of O2 and an unknown gas were allowed to effuse through…

A: Step 1:

Q: help please answer in text form with proper workings and explanation for each and every part and…

A: Given: Si+SO42−→SO32−+SiO32−Step 1: Write the half-reaction.SO42−→SO32−Si→SiO32− Step 2:…

Q: Predict and draw the structure organic product from the reaction below: 3 pts 1. NaNH2 2. CH3CH2Br

A: The objective of the question is to predict and draw the structure of the organic product from the…

Q: None

Q: 1. Consider the reaction: HC2H3O2 (aq) + H2O (l) = H3O+ (aq) + C2H3O2 (aq) W.A If you start out with…

A: HC₂H3O2 (aq) +H₂O (l) = H3O+ (aq) + C₂H3O2-(aq) Given 0.15M = HC₂H3O2 (aq), H₂O (l) 0.001M = H3O+…

Q: if a balloon is filled with 0.250 mole of air at 35°C. If the volume of the balloon is 6.23 liters,…

Q: Molarity 1. What quantity is represented by the slope of the dashed line in the accompanying diagram…

A: The question is asking about the meaning of the slope of a line in a graph that represents the…

Q: Curved arrows are used to illustrate the flow of electrons. Using the provided resonance structures,…

A: Step 1:In the first step, the negative charge is transferred and carbon-oxygen double bond is…

Q: help q9

Q: Part A D How much heat in kilojoules is evolved in converting 2.00 mol of steam at 150 °C to ice at…

A: The objective of the question is to calculate the total heat evolved in converting 2.00 mol of steam…

Q: 2. Draw the product and the mechanism for the following reaction. (hint: ẞ-silicon effect) Ph TMS…

Q: AS-5. The electrophilic aromatic substitution reaction is exothermic. Which potential energy…

A: Ans: Option A.

Q: Find the concentration of H+ in a 1.75 M solution of lactic acid, HC3H5O3, at 25°C. Ka= 1.38 x 10-4

A: The objective of this question is to find the concentration of H+ ions in a 1.75 M solution of…

Q: 1. Predict the product(s) and DRAW the MECHANISMS of the following reactions. HBr HBr -78C A

A: Step 1: Buta-1,3-diene on reaction at different temperatures gives two different…

Q: None

Question

For the reaction CO(g) + Cl2(g)=COCI2(g) Kc = 255 at 1000 K. A reaction mixture initially contains a CO concentration of 0.1510 M and a Cl2 concentration of 0.176 M at 1000 K. What is the equilibrium concentration of COC12 at 1000
K ?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Similar questions

At 2300 K the equilibrium constant for the formation of NO(g) is 1.7 103. N2(g) + O2(g) 2 NO(g) (a) Analysis shows that the concentrations of N2 and O2 are both 0.25 M, and that of NO is 0.0042 M under certain conditions. Is the system at equilibrium? (b) If the system is not at equilibrium, in which direction does the reaction proceed? (c) When the system is at equilibrium, what are the equilibrium concentrations?
The equilibrium constant for the dissociation of iodine molecules to iodine atoms I2(g) 2 I(g) is 3.76 103 at 1000 K. Suppose 0.105 mol of I2 is placed in a 12.3-L flask at 1000 K. What are the concentrations of I2 and I when the system comes to equilibrium?
At room temperature, the equilibrium constant Kc for the reaction 2 NO(g) ⇌ N2(g) + O2(g) is 1.4 × 1030. Is this reaction product-favored or reactant-favored? Explain your answer. In the atmosphere at room temperature the concentration of N2 is 0.33 mol/L, and the concentration of O2 is about 25% of that value. Calculate the equilibrium concentration of NO in the atmosphere produced by the reaction of N2 and O2. How does this affect your answer to Question 11?
Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
Kc = 5.6 1012 at 500 K for the dissociation of iodine molecules to iodine atoms. I2(g) 2 I(g) A mixture has [I2] = 0.020 mol/Land [I] = 2.0 108 mol/L. Is the reaction at equilibrium (at 500 K)? If not, which way must the reaction proceed to reach equilibrium?
Suppose a reaction has the equilibrium constant K = 1.3 108. What does the magnitude of this constant tell you about the relative concentrations of products and reactants that will be present once equilibrium is reached? Is this reaction likely to be a good source of the products?
Kc for the decomposition of ammonium hydrogen sulfide is 1.8 104 at 25 C. NH4HS(s) NH3(g) + H2S(g) (a) When the pure salt decomposes in a flask, what are the equilibrium concentrations of NH3 and H2S? (b) If NH4HS is placed in a flask already containing 0.020 mol/L of NH3 and then the system is allowed to come to equilibrium, what are the equilibrium concentrations of NH3 and H2S?
For the reaction N2(g)+3H2(g)2NH3(g) show that Kc = Kp(RT)2 Do not use the formula Kp = Kc(RT)5n given in the text. Start from the fact that Pi = [i]RT, where Pi is the partial pressure of substance i and [i] is its molar concentration. Substitute into Kc.
Consider the following equilibria involving SO2(g) and their corresponding equilibrium constants. SO2(g) + 12 O2(g) SO3(g) K1 2SO3(g) 2SO2(g) + O2(g) K2 Which of the following expressions relates K1 to K2? (a) K2=K12 (b) K22=K1 (c) K2 = K1 (d) K2 = 1/K1 (e) K2=1/K12
The atmosphere consists of about 80% N2 and 20% O2, yet there are many oxides of nitrogen that are stable and can be isolated in the laboratory. (a) Is the atmosphere at chemical equilibrium with respect to forming NO? (b) If not, why doesnt NO form? If so, how is it that NO can be made and kept in the laboratory for long periods?
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
A solution is prepared by dissolving 0.050 mol of diiodocyclohexane, C5H10I2, in the solvent CCl4.The total solution volume is 1.00 L When the reaction C6H10I2 C6H10 + I2 has come to equilibrium at 35 C, the concentration of I2 is 0.035 mol/L. (a) What are the concentrations of C6H10I2 and C6H10 at equilibrium? (b) Calculate Kc, the equilibrium constant.