Give the IUPAC name of the following alcohols: a. CH;CH2CH2CH2CH2CH2CH2CHCH2CH3 OH b. CH3CHCH2CHCH2CH2CH2CHCH2CH3 CH3 CH3 OH CH3CHCH2CHCH2CH2CH2CHCH2CH3 ОН CH3 OH d. ÇH2CH2CH2 OH OH
Q: What alkenes are formed when attached alcohol is dehydrated with TsOH?Label the major product when a…
A: Given,
Q: ) Which of the following compounds will be most soluble in ethanol (CH3CH2OH)? A) ethylene glycol…
A: Compound that will be most soluble in ethanol (CH3CH2OH) is to be selected. A) Ethylene glycol…
Q: Explain why dimethyl ether and ethanol are both water soluble, but the boiling point of ethanol…
A:
Q: CH3 CHạCOH CHYCHCH2CH,CH2l B
A: The organic products are drawn in the next step:
Q: Give the IUPAC name for each compound. a. C. b. d. f.
A:
Q: Draw the organic products formed when attached allylic alcohol A is treated with following reagent.…
A:
Q: B. Give the common name for each ether. (a) H3C-0-CH2CH3 (b) H3C-0-CH3
A: The given compounds have an "ether" functional group.
Q: Give the IUPAC name for each ketone: CH3 (CH3)3C. b. c. (CH3)3CCOC(CH3)3 a. Name the following…
A:
Q: What alcohol starting material is needed to prepare each carbonyl compound as a product of an…
A: Alcohols are oxidized to formaldehyde, ketone and carboxylic acids.
Q: Give the IUPAC name for each aldehyde. CHO CHO a. (CHa),CC(CH3),CH,CHO b. С. С- CI
A: The IUPAC name of given aldehydes has to be provided. (a) The given aldehyde is…
Q: Give a common name (when possible) and a systematic name for each compound.(a) CH3OCH“CH2
A: Systematic Name: It is a standardized name given for a chemical compound in systematic manner. Any…
Q: Give the structure corresponding to each IUPAC name. a. 2-methoxypropane b. cyclobutyl ethyl ether…
A: Since you have posted multiple sub-parts, the answer for first three sub-parts are given below.…
Q: What is the IUPAC name ofthis structure? HO (E)-4-methylhex-4-en-1-ol (2-4-methylhex-4-en-1-ol…
A:
Q: Give the IUPAC name for each alcohol HỌ CH3 (CH),CHCH,CHCH,CH3 CH̟CH,CH,OH CH,CHCH,CH,CH3 b. а. Но.…
A: Note: According to our guidelines we are supposed to answer only one question. Kindly repost other…
Q: 3) Which aa has the strongest acid side chain? b) H2N-CH-ċ-OH H2N- -сн—с—он CH2 CH2 CH2 CH2 =0 O:…
A: Solution: We know the carboxylic acids are most acidic than other organic compounds like alcohol,…
Q: OCH3
A: The compound given for naming is an ether .
Q: Give a common name (when possible) and a systematic name for each compound. ) (h) CH3C‚CCH2OCH3
A: For every chemical compound, there is a common name that can be used commonly within the individuals…
Q: Give an IUPAC or common name for each compound.
A: (a) The functional group present in the given compound is acid chloride. The parent chain consists…
Q: What alcohol can be oxidized to each carboxylic acid?
A: Carboxylic acids are the carbon compounds that contain carboxyl group as a major functional group.…
Q: Rank the following species in each set from best nucleophile to poorest nucleophile.
A: Aprotic solvent are polar solvent molecules which do not have hydrogen bonded to oxygen to nitrogen.…
Q: Give the IUPAC name for each aldehyde.
A: Concept introduction: For naming an aldehyde in IUPAC nomenclature, the suffix –al is added to the…
Q: ОН CN Ph Ph A – 1. Ph2Cu- Li*/ether. 2. H3O* B- PhLi/ether C- 1. PhMgBr/THF 2. H3O* D- PHNH2 E-…
A:
Q: Write IUPAC name of the major product formed as a result of the reaction indicated .CH3 Pd + H2 ?
A: In this given reaction, The 1-methylcyclopent-1ene reactant is a starting material or reactant is…
Q: Label the functional group(s) in each compound as ethers or acetals.
A: In organic chemistry, functional groups are the atom or substituent which is responsible for the…
Q: OH CH;CH,CHCHOCH,CH3 CH3
A: Applying definition of acetal and hemiacetal.
Q: The common name for the follouing compound Ps: a) disec -butyl-ether b) dPbutyl ether c) I-…
A:
Q: (a) Give an acceptable name for compound A. (b) Draw the organic products formed when A is treated…
A: Rules to name the compound. 1) First locate the longest carbon chain.2) Then locate all the groups…
Q: Write IUPAC name of the major product formed as a result of the reaction indicated CH3 H3C H* + H20
A:
Q: (a) Give the IUPAC name for A and B. (b) Draw the product formed when A or B is treated with each…
A:
Q: 4. Give the IUPAC names for the following molecules a) b)
A: IUPAC nomenclature system is basically a method to determine the names of organic molecules in a…
Q: Give the IUPAC name for each the following compound: a. CH;CH2CH,C(CH3)2CH2COOH b.…
A:
Q: What carboxylic acid and alcohol are needed to prepare each ester byFischer esterification?
A: The given compounds are esters. The given reaction is the Fischer esterification. In the Fischer…
Q: (a) Give an acceptable name for each compound, (b) Draw the organic products formed when A or B is…
A:
Q: Explain the propertis of ethers that muke them a very weful as menstruum.
A: The main properties of ether because of which it acts as menstruum i.e a solvent are
Q: Part 1: Draw the organic product of the reaction. + OCH(CH3)2 view structure Part 2 out of 2…
A: symmetrical ether - substituent on both side of oxygen is same
Q: Give the IUPAC name for each compound. OH a. CH3CH(CH₂)4CH3 (select) OH L (CH3CH₂)2CHCHCH₂CH3…
A: The chemical compounds are named according to the guidelines set up by the IUPAC. The first step is…
Q: explain the following observations a. propanol is more water soluble than propane b. propanol is…
A: In water we have 2 O-H bonds which has very strong H bonding So when we add any molecule with O-H…
Q: THC is the active component in marijuana, and ethanol is the alcohol in alcoholic beverages. Explain…
A: Since the ethanol has very small hydrophobic chain while THC has very large hydrophobic structure…
Q: Draw the organic products formed when allylic alcohol A is treated with each reagent.a.H2 + Pd-C…
A: (a). Catalytic hydrogenation of allylic alcohol reduces the double bond to single bond giving…
Q: Write the IUPAC and, where possible, a common name for each compound.
A: Write the IUPAC and, where possible, a common name for each compound.
Q: Give the IUPAC name for each compound. a. Он OH он он d.
A: a. First, number the carbon atoms that form the longest chain starting from the high priority side.…
Q: Give a systemic name for each compound CH3 (е) (CH),С—о-сн CH,CH,
A: A question based on nomenclature, which is to be accomplished.
Q: Write IUPAC name of the major product formed as a result of the reaction indicated CH3 H3C Ni + H2
A: The reaction given is,
Q: D. is a monohydric alcohol contai To be oxidized by normal oxidizing ageni (a) 2-pentanol (b)…
A: The given alcohols are: 2-pentanol, 2-methyl-2-butanol, 3-methyl-2-butanol, 3-methyl-1-butanol To…
Q: Ofa/?tstamp3D1651674579 PART 1: TRUE OR FALSE. Choose A If the statement is true. Otherwise, choose…
A:
Q: 3. You all know the carbonyl structure. It is carbon atom double bonded to the oxygen atom. a. Draw…
A: Carbonyl structure is a carbon atom doubly bonded to the oxygen atom . Since, Oxygen atom is more…
Q: Which of the following will NOT be soluble in water? CH3 A. H3C-CH-CH2-CH2 H3C-CH2-CH2-C= C. D. All…
A: 1. A hydrocarbon is an organic chemical compound composed exclusively of hydrogen and carbon atoms.…
Q: Draw the organic product of the reaction. + "OCH(CH3)2 view structure Part 2 out of 2 Classify the…
A: Symmetrical and unsymmetrical ether depends upon substient attached with oxygen atom
Q: Write IUPAC and common names for ethers.
A:
Q: D) CH b) CH3(CH2)6CH2OH a) OH c) C6H5OH d) C6H5CH2NH2 e) CH3(CH2)6CI f) CH3CH=CH(CH2)4CH3 g) NH2 h)…
A:
Give the IUPAC name of the following alcohols
Trending now
This is a popular solution!
Step by step
Solved in 2 steps with 1 images
- 10. Give the IUPAC name for each of the following compounds. a) CH3CH2CH₂CH₂CHCICH2CH₂CH3 CI F b) CH3CH₂ CH3CHCH₂CHCH 3 I F CH3CH₂CHCH₂CHCH₂CH3 HCH₂CH3 d)Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l)CH3CH2CH2CO2H(l)+CH2CH3OH(l)⟶H+CH3CH2CH2CO2CH2CH3(l)+H2O(l) A chemist ran the reaction and obtained 5.40 g of ethyl butyrate. What was the percent yield, The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.45g of butanoic acid and excess ethanol?Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Part A Given 7.30 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. Part B A chemist ran the reaction and obtained 5.95 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. Part C The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 7.30 gg of…
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.45 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. A chemist ran the reaction and obtained 5.50 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 8.45 gg of butanoic acid and excess…Provide the classification (alcohol or ether) and provide the correct IUPAC name of each molecule. CH3 H3C. ОН b) Namena 1a) Classification: CH3 H3C. b) Namena 2a) Classification: CH3 H3C CH3 b) Nameina 3a) Classification: CH3 H3C он b) Namena 4a) Classification: CI H3C. CH3 OH ÓH CI b) Namena 5a) Classification:Define the Reaction of Ethers with Strong Acid ?
- CH,CH,CH,-OH Draw the structure of the product expected when each of the following alcohols is reacted with a sulfuric acid catalyst au the temperature indicated. H,SO, CH,-CH-CH, 180°C a. OH H,SO, CH, — CH—СH,—ОН 180°C b. CH; H,SO, CH-CH-OH 140°C с. CH, CH,-CH-CH,-CH, H,SO, d. 140°C d. OHGive the IUPAC and common name for the following compounds. a. HO, b. но OHWhat is the IUPAC name of the following compound? CH;CH=CCH2CH2OH (A) 3-Phenylpent-3-enol B 3-Phenylpent-2-enol C 3-Benzenepent-3-enol D 3-Phenylpent-2-en-5-ol E 5-Hydroxy-3-phenylpent-2-ene
- Indicate the product obtained by reacting A and B. A || H3C-S-CH₂ Na* || CH 3 B CH2. C. CH3 H3C CH3Explain why diethyl ether (CH3CH2OCH2CH3) and butan-1-ol (CH3CH2CH2CH2OH) have similar solubility properties in water, but butan-1-ol has a much higher boiling point.9. Which compounds react together to form an ester? CH3CH₂OH CH3CH₂COOH II. CH3CH CHO IV. CH3CH₂COCH3 I. III. I and IV only II and III only I and III only D) Both I and II and I and IV would produce esters. A) B) C)