How many moles of O2 will be formed from 5.60 moles of KCIO3 for the following reaction? Answer to 2 decimal places. The unit for mole is mol. 2 KC103 → 2 KCl + 302 → 2 KCI + 3 O2 Your Answer: Answer units

How many moles of O2 will be formed from 5.60 moles of KCIO3 for the following reaction? Answer to 2 decimal places. The unit for mole is mol. 2 KC103 → 2 KCl + 302 → 2 KCI + 3 O2 Your Answer: Answer units

General, Organic, and Biological Chemistry

7th Edition

ISBN:9781285853918

Author:H. Stephen Stoker

Publisher:H. Stephen Stoker

Chapter6: Chemical Calculations: Formula Masses, Moles, And Chemical Equations

Section: Chapter Questions

Problem 6.61EP: For the chemical reaction Sb2S3+6HCl2SbCl3+3H2S write the conversion factor that would be needed to...

See similar textbooks

Related questions

Q: Given the following reaction : 4NH3(g) + 3 O2 (g) > 2N2 (g) + 6H2O (I) Calculate ∆G° 298

A: The standard thermodynamic data for the given reactants and products at given temperature is, 4NH3…

Q: If the percent yield of the reaction below is 78%, how many grams of chlorine gas are needed to…

A: The stoichiometric coefficients of a reaction represents the number of moles of reactants and…

Q: How many moles of NH3 are produced when 0.45 moles of H2 gas react with N2 gas? N2 + 3H2 -->2 NH3…

A: The balanced reaction taking place is given as, => N2 + 3 H2 -----> 2 NH3

Q: 500 mL 0.4 M aluminum nitrate solution contains ________ moles of aluminum ions and ________ moles…

A: 1M Al(NO3)3 solution means 1 mole Al(NO3)3 is present in 1000 mL solution. So, 1000 mL 1M Al(NO3)3…

Q: For the reaction 2 C4H10 + 13 O2 → 8 CO2 + 10 H2O, if 51.60 g of CO2 is produced, how much C4H10 was…

A: 2C4H10 + 13O2 → 8CO2 + 10H2O From this Balanced chemical equation we get that ; 2 mol C4H10 produce…

Q: 15.00g of aluminum sulfide and 10.0g of water react until the limiting regeant is used up:…

A: Given information, AI2S3+6H2O=2AI(OH)3+3H2S 15.00g of aluminum sulfide and 10.0g of water

Q: observe

A: The chemical reaction is: 6 NH3(g) + 8 O3(g) --> 3 N2O5(g) + 9 H2O(g) According to the balanced…

Q: 5.0 moles of sucrose ( C12H22O11 ) are in a batch of candy. All carbon becomes CO2 when…

A: The overall reaction for the metabolism of sucrose can be written as, C12H22O11 +12 O2 →12 CO2 + 11…

Q: Calculate the amount in grams of citric acid that you would need to complete the reaction for the…

A: To calculate the amount in grams of citric acid that we would need to complete the reaction for the…

Q: hy is there not a coefficient for O2? . How many hydrogen atoms are needed to produce two H2O…

A: Step -l : Hydrogen and oxygen combines to form water molecule . Here is the…

Q: C4H10 + O2 → CO2 + H2O (unbalanced) What mass of CO2 is produced in the complete combustion of 78.8…

Q: How many moles of oxygen gas are required when 0.52 moles of carbon dioxide are produced? 2C8H18…

A: Given balanced equation: 2C8H18 (l) + 25O2 (g) --> 16CO2 (g) + 18H2O (g)

Q: For the reaction N2+3H2->2NH3, find the mass of N2 needed to react to form 0.341g of NH3 ? Three…

Q: What mass of NH3 remains after a mixture of 25.0 g of NH3 and 25.0 g of HCI undergo reaction? NH3(g)…

A: The equation of reaction is, NH3 + HCl → NH4Cl1mol 1mol 1mol molar mass of HCl is…

Q: If the # of moles of sodium carbonate you used was 2.75 x 10^ -2 and the number of moles of cobalt…

A: Given: The number of moles of sodium carbonate and cobalt chloride is 2.75×10-2 mol and 3.30×10-2…

Q: Given the following unbalanced reaction, answer parts a, b, c, and d. (Not all choices will be used)…

A: Since we only answer up to 3 sub-parts, we’ll answer the first 3. Please resubmit the question and…

Q: react to form aqueous nitric acid and nitrogen monoxidegas. Suppose you have 7.0 mol of NO2 and 9.0…

Q: In the acetylene torch, acetylene gas (C2H2) burns in oxygen to produce carbon dioxide and water.…

A: The given reaction is,

Q: The amount of oxygen in the reactants is 4 atoms. In the products, the oxygen is distributed to…

A: The chemical equations should be balanced in accordance with the law of conservation of mass. This…

Q: For the reaction 2 H2O → 2 H2 + O2, how many moles of O2 are produced with 1.45 moles of H2? Your…

A: Given Reaction 2H2O → 2H2 + O2 Number of mole of H2 = 1.45 mole Number of mole of O2 = ?…

Q: How many moles of O2 will be formed from 2.00 moles of KCIO, for the following reaction? Answer to 2…

A: Given balanced reaction: 2 KClO3 → 2 KCl + 3 O2 The number of moles of KClO3 reacted = 2.00 moles.…

Q: A container holds 15.0 g of P4O6 and 6.00g of O2 The following reaction occurs: P4O6 +2O2=P4O10 if…

A: Balance chemical equation : P4O6 + 2O2 →…

Q: How many liters of Ferric Hydroxide is produced when 10.5 L of Ferric oxide is pressed into water?…

A: First write down the balance equation for given reaction and then find out volume of ferric…

Q: how many moles of O2 is in excess when the reaction is over? Do not include

A: Solution: The given reaction: 4NH3 + 5O2 → 4NO + 6H2O From the stoichiometry we can find theoretical…

Q: For the balance equation shown below, how many moles of SO3 will react with 0.7727 moles of C4H8S2?…

Q: Determine the limiting reactant and how much of that limiting reactant you would need in order to…

Q: A student is trying to figure out how many moles of potassium chloride are made from 4.0 grams of…

Q: How many moles of H3PO4 are produced when 73.6 g P4010 reacts completely to form H3PC P4010(s) +…

A: The given data : The mass of P4O10 = 73.6 g To determine : The moles of H3PO4

Q: Glucose oxidation is a chemical process that provided energy for an organism to carry out all of its…

A: Given, chemical equation for the oxidation of glucose (C6H12O6) : C6H12O6(aq) + 6O2(aq) ---->…

Q: How many moles of Al will be consumed when 0.800 mol of Al2O3 are produced in the following…

A: the relation between the mole of reactant with the mole of product is known as stoichiometric…

Q: In the equation - 2HgO(s) --> 2Hg(l) + O2(g) How many moles of HgO are needed to produce 2 moles of…

Q: Determine the number of molecules of Cr2o3 that form when 1.34x10^3g of oxygen completely reacts…

A: Moles of oxygen=1.34×10316=83.75 mol4Cr(s)+3O2(g) →2CrO3(s)From the chemical reaction,3 moles of…

Q: For the reaction 2 CĄH10 + 13 O2 → 8 CO2 + 10 H2O, if 59.20 g of CO2 is produced, how much C4H10 was…

Q: 1. Below are 3 possible decompositions reactions for NaHCO3. Use stoichiometry to predict the…

Q: How many moles of H3PO4 are produced when 82.2 g P4O10 reacts completely to form H3PO4?…

Q: when 5.20 x 10mol of N2Os gas completely reacts: 2 N2Os(g) - 4 NO2(g) + O2(g) ING AMOUNT ADD FACTOR…

A: Applying concept of yield of reaction.

Q: If 1.02 * 1025 molecules of CuCl2 react with excess potassium (K) how many moles of KCl will be…

A: As pottasium is in excess therefore net balance reaction is , CuCl2 + 2K ----> 2KCl + Cu Number…

Q: Calculate Kc for each of the following reactions:

A: Kc is the equilibrium constant that is the ratio of product concentration with proper power and…

Q: determining how many moles of oxygen are needed to react with 2700g of gasoline? (C10H20)

A: The reaction can be given as: The above reaction shows that 1 mole of C10H20 requires 15 moles of…

Q: Given the equation C4H6 + 2HBr ---> C4H8Br2 Calculate the moles of C4H8Br2 produced when 1.5 nole…

A: The given reaction is- C4H6+2HBr→C4H8Br2 From this reaction, it is clear that 1 mol of C4H6 reacts…

Q: How many moles of oxygen gas are produced when 6.44 moles of water are produced? 2H2O2 (l) --> O2…

A: To find the moles of oxygen produced, the moles of water is given.

Q: Consider the following reaction at STP: 2 H2S(g) + SO2(g) → 3 S(s) + 2 H2O(g) How many moles of S…

A: Considering the given reaction: 2 H2S(g) + SO2(g) → 3 S(s) + 2 H2O (g) 2 mol 1 mol 3…

Q: .Given the following balanced chemical equation, how many grams of O2 would be produced from 21.44 g…

A: The question is based on Reaction Stoichiometry. We have to calculate how much oxygen is produced by…

Q: For the following balanced equation: CH4 + 4 Cl2 ==> CCl4 + 4 HCl Determine the number of moles of…

A: Number of moles formed depend balance reaction

Q: If 20.0g of each reactant is present initially in the following reaction, determine the limiting…

A: The balanced reaction given is, => CS2 (g) + 3 O2 (g) → CO2 (g) + 2 SO2 (g) Given: Mass of each…

Q: Consider the following balanced chemical reaction which occurs during glycolysis. 2 C6H12O6 + 2…

A: Mole concept proposes that, 1 mole of a substance is equal to the molecular weight of that…

Q: Solid phosphorus (P)and chlorine (C1₂) gas react to form solid phosphorus pentachloride (PCI).…

A: The number written before the chemical formula of a compound in a chemical equation is known as its…

Q: For each of the following balanced chemical equations, calculate how many moles and how many grams…

A: NOTE: Since you have not bolded the reactant. Hence I'm giving an answer assuming both the reactants…

Q: Consider the following balanced reaction. How many moles of C3H7SH are needed to produce 0.296 moles…

Q: of oxygen (O2) are available in the balanced combustion reaction below: C3H8 + 5 O2 -> 3 CO2…

A: Combustion of propane. Here 1.025 moles of CO2 produced from 89.6 g of O2 1.243 moles of CO2 from…

Question

100%

How many moles of O, will be formed from 5.60 moles of KCIO3 for the following
reaction? Answer to 2 decimal places. The unit for mole is mol.
2 KC1O3 → 2 KCl + 3 O2
Your Answer:
Answer
units

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

Carbon dioxide from the atmosphere weathers, or dissolves, limestone (CaCO3) by the reaction CaCO3(s)+CO2(g)+H2O(l)Ca2(aq)+2HCO3(aq) Obtain H for this reaction. See Table 6.2 for the data.
Write the balanced chemical equation for the complete combustion of heptene, C7H14. In combustion, hcpLcnc reacts with oxygen to produce carbon dioxide and water. What is the mole ratio that would enable you to calculate the number of moles of oxygen needed to react exactly with a given number of moles of heptene? What mole ratios would you use to calculate how many moles of each product form from a given number of moles of heptene?
Write the balanced chemical equation for the complete combustion of adipic acid, an organic acid containing 49.31% C, 6.90% H, and the remainder O, by mass.
3.81 The particulate scale drawing shown depicts the products of a reaction between H2 and O2 molecules. (a) Draw a similar representation for the reactants that must have been present before the reaction took place. (b) Write a balanced chemical equation for the reaction, using the smallest possible whole number coefficients.
You have seven closed containers, each with equal masses of chlorine gas (Cl2) . You add 10.0 g of sodium to the first sample, 20.0 g of sodium to the second sample, and so on (adding 70.0 g of sodium to the seventh sample). Sodium and chlorine react to form sodium chloride according to the equation 2Na(s)+Cl22NaCl(s) After each reaction is complete, you collect and measure the amount of sodium chloride formed. A graph of your results is shown below. Answer the following questions: a. Explain the shape of the graph. b. Calculate the mass of NaCl formed when 20.0 g of sodium is used. c. Calculate the mass of Cl2 in each container. d. Calculate the mass of NaCl formed when 50.0 g of sodium is used. e. Identify the leftover reactant, and determine its mass for parts b and d above.
Freon-12, CCl2F2, is prepared from CCl4 by reaction with HF. The other product of this reaction is HCl. Outline the steps needed to determine the percent yield of a reaction that produces 12.5 g of CCl2F2 from 32.9 g of Cd4. Freon-12 has been banned and is no longer used as a refrigerant because it catalyzes the decomposition of ozone and has a very long lifetime in the atmosphere. Determine the percent yield.
4.72 The picture shown depicts the species present at the start of a combustion reaction between methane, CH4 and oxygen, O2 (a) What is the limiting reactant? (b) Draw the resulting state after this set of reactants has reacted as far as possible.
or each of the following reactions, give the balanced chemical equation for the reaction and state the meaning of the equation in terms of individual molecules and in terms of moles of molecules. msp;MnO2(s)+Al(s)Mn(s)+Al2O3(s) msp;B2O3(s)+CaF2(s)BF3(g)+CaO(s) msp;NO2(g)+H2O(l)HNO3(aq)+NO(g) msp;C6H2(g)+H2C6(g)H12(g)
A weighed sample of iron (Fe) is added to liquid bromine (Br2) and allowed to react completely. The reaction produces a single product, which can be isolated and weighed. The experiment was repeated a number of times with different masses of iron but with the same mass of bromine (see graph below). (a) What mass of Br2 is used when the reaction consumes 2.0 g of Fe? (b) What is the mole ratio of Br2 to Fe in the reaction? (c) What is the empirical formula of the product? (d) Write the balanced chemical equation tor the reaction of iron and bromine. (e) What is the name of the reaction product? (f) Which statement or statements best describe the experiments summarized by the graph? (i) When 1.00 g of Fe is added to the Br2, Fe is the limiting reagent. (ii) When 3.50 g of Fe is added to the Br2, there is an excess of Br2. (iii) When 2.50 g of Fe is added to the Br2, both reactanu are used up compietely. (iv) When 2.00 g of Fe is added to the Br2, 10.8 g of product is formed. The percent yield must therefore be 20.0%.
onsider the balanced chemical equation :math>4Al(s)+3O2(g)2Al2O3(s). at mole ratio would you use to calculate how many moles of oxygen gas would be needed to react completely with a given number of moles of aluminum metal? What mole ratio would you use to calculate the number of moles of product that would be expected if a given number of moles of aluminum metal reacts completely?
3.50 A test of an automobile engine's exhaust revealed that g of NO2 was emitted in 10 minutes of operation. How many moles of NO2 would this engine release if it were used for a 45-minute commute, assuming that this mea- sured number is representative of the emission under all circumstances?
For the chemical reaction Sb2S3+6HCl2SbCl3+3H2S write the conversion factor that would be needed to do each of the following one-step conversions. a. Moles of SbCl3 to moles of H2S b. Moles of Sb2S3 to moles of HCl c. Moles of H2S to moles of HCl d. Moles of Sb2S3 to moles of SbCl3