In acidic aqueous solution, the purple complex ion Co(NH3)5Br2+Co(NH3)5Br2+ undergoes a slow reaction in which the bromide ion is replaced by a water molecule, yielding the pinkish-orange complex ion : Co(NH3)5(H2O)3+Co(NH3)5(H2O)3+ Co(NH3)5Br2+Purple(aq)+H2O(l)→Co(NH3)5Br2+Purple⁡(��)+H2O(�)→ Co(NH3)5(H2O)3+Pinkish−orange(aq)+Br−(aq)Co(NH3)5(H2O)3+Pinkish−orange⁡(��)+Br−(��) The reaction is first order

Q: OH Step 1 OH Step 3 Step 2 1-cyclohexylpropan-1-one

A:

Q: Draw the structural condensed formula of 5,5-dimethyl-1-hexyne.

A: Since, In condensed structural formula, All the atom written in one line without any space left.

Q: The chemistry of nitrogen oxides is very versatile. Given the following reactions and their standard…

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: * H₂CO NaOCH; CH₂OH NO₂ HNO3, H₂SO4

A: The ring opening of an epoxide in a basic medium involves the cleavage of the three-membered ring to…

Q: Calculate the degree of unsaturation (DU) for the molecule shown below. Но НО ОН Н .N.

A:

Q: If the mercury in a barometer raises 28.2 centimeters due to a change in ambient pressure, what is…

A: Pressure can be easily converted from one to another unit by use of dimensional analysis. For this…

Q: Propose an efficient synthesis for the following transformation. x-1 The transformation above can be…

A: The question is based on the concept of organic synthesis.  we need to synthesize the product using…

Q: Propylamine, C3H7NH2, is a weak monoprotic base with Kb = 3.5 × 10−4. Calculate the pH of a 0.00541…

A:

Q: 1. Consider the electrophilic aromatic substitution reaction below. Provide the major product and…

A: Benzene derivative gives electrophilic substitution reaction with halogen in presence of Lewis acid…

Q: X

A: The given chemical compounds are a class of aliphatic carbon-carbon triple bond containing…

Q: If the Ka of acetic acid is 1.8 x 10-5, what is the pH of a .15M acetic acid solution? Group of…

A: The question is based on the concept of pH of the solution.  it is defined as a negative logarithm…

Q: Consider the following reaction at equilibrium.                           2 NH3(g) ---> N2(g) + 3…

A:

Q: Draw the structure of the following compound and write an equation for its synthesis from respective…

A: Rules for IUPAC naming :- Select the longest chain which contains carbon-carbon single bonds.…

Q: References Use the References to access Important values if needed for this question. For the…

A: Iron(s) + chlorine (g) --> Iron(III) chloride(s) mass of Iron (Fe) reacts = 6.39 g Excess…

Q: a) Identify the alkyl halide (i.e., an alkane chain attached to a halogen) as primary, secondary, or…

A: The question is based on the concept organic chemistry. we need to identify the alkyl halides and…

Q: O Macmilla une fect arol organic pr 1. KMnO4, HO-, heat 2. H3O+ the following action, une Select…

A: Potassium permanganate is a strong oxidizing agent

Q: 5. Design a synthesis the following target from the given aldehyde. sm H Target

A:

Q: Nitric acid could be used to neutralize calcium hydroxide. If you have 2.71 L of a 1.93 M calcium…

A:

Q: 3. Add the mechanism arrows to the reactions below to show the breaking and formation of the bonds.…

A: Elimination reaction in which the dehydrohalogenation takes place. Elimination reactions are two…

Q: how many moles of CO2 are expected from 0.01428 moles of baking soda NaHCO3 in the equation NaHCO3…

A: Given, moles of NaHCO3 reacted = 0.01428 mol moles of CO2 produced/expected = ?  In this type of…

Q: For a particle-in-a 3-D box with a-b-c (cubic), the energy is given by h² ² + 1²₂²) 8ma² (n₂ ² +n ²+…

A: Since, Degeneracy can be defined as energy (E0) is same but number of states (nx,ny,nz) are…

Q: 1 or 2 diffused peaks ~3300-3000 cm-1 big U at 3300 cm-1 spike at 3300 cm-1 3300-3000 cm-1 3000-2850…

A: Infrared (IR) spectroscopy is a technique used to identify and analyze the chemical bonds present in…

Q: omplete the mechanism for the keto-enol tautomerization shown using bonds, charges, nonbonding…

A: Enol form in acidic condition tautomerizes to keto form. At first pi bond attacks electrophilic H+ .…

Q: For the exothermic reaction PCl3(g)+Cl2(g)⇌PCl5(g) Kp = 1.40×10−3 at a certain temperature. A flask…

A:

Q: Literature melting point of the dibromo-product is 203-204oC and assuming your crude melting point…

A: In organic chemistry, purification of crude products is an essential step in obtaining a pure…

Q: How many moles of water are produced from 19.2g of B_(2)H_(6) ?

A:

Q: H3CO N(CH3)3 NaOH ; (Hoffman elim.) C19H2402 [4+2] ?

A: The 4+2 cycloaddition is a type of chemical reaction where a 4π electron system (a diene) reacts…

Q: According to the following reaction, how many grams of nitrogen monoxide will be formed upon the…

A:

Q: 1 or 2 diffused peaks ~3300-3000 cm-1 big U at 3300 cm-1 spike at 3300 cm-1 3300-3000 cm-1 3000-2850…

A: Infrared (IR) spectroscopy is a technique used to identify and analyze the chemical bonds present in…

Q: Write an introduction on Chromium(II) Acetate Hydrate - Cr2(CH3COO)4(H2O)2 Discuss it's structure,…

A: Chromium(II) Acetate Hydrate has a general molecular formula of C8H16Cr2O10 with a molar mass of…

Q: Consider the following balanced thermochemical equation for a reaction sometimes used for H₂S…

A:

Q: 2.Circle the peak(s) that would be present in an IR spectrum to indicate the presence a carboxylic…

A: 2) Infrared (IR) spectroscopy is a technique used to identify and analyze the functional groups…

Q: Consider the dissolution of CaCl₂: CaCl₂ (8)→ Ca²+ (aq) + 2 C1 (aq) AH = -81.5 kJ An 11.1-g sample…

A: Mass of CaCl2 = 11.1 g∆H for the dissolutio of CaCl2 is -81.5kJ Mass of water = 124 gInitial…

Q: Based on the foregoing discussion, which shows a concerted process, what is the ex- pected product,…

A: PBr3 helps to conver alcohol OH to Br with inversion of stereochemistry .

Q: 23). What is the major product of the following reaction? of Br (A) CH3 (B) Br Br Br₂ (Exess) NaOH…

A:

Q: 3. Construct energy-level diagrams for both high- and low- spin situations for the dº electron…

A: High Spin Configuration: In the high spin configuration, the electrons occupy the higher energy…

Q: 1) When 4.90 g NaOH(s) is reacted with 200.0 mL 0.612 M HCl(aq), the temperature increases 14.63…

A: Since you have posted multiple questions, we can solve only the first question for you according to…

Q: 2/+ 273K 1. A weather balloon is filled with 3.3 x 10 L of hydrogen at a temperature of 21 °C and a…

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: Provide the correct IUPAC name for the compound shown here. CI 4

A:

Q: Show the reagents you would use to achieve the following transformation. 0-00 The transformation…

A: Ozonolysis is the formation of carbonyl compounds from the alkenes. It form the ozonide is the…

Q: Yes, but how did you come up with the molecule at the end? As in, what steps did you take? Did you…

A: No, it is not random. The chemical shift and the multiplicity tells us about the structure of the…

Q: Charles' law as an equation is V T An expression for the final volume, V₂, occupied by a gas from…

A: Final volume=V2 Initial volume=V1 Initial temperature=T1 Final temperature=T2 We need to write the…

Q: Give detailed Solution with explanation needed..please give correct answer

A: We have been given an organic compound. We have been asked that which atom of given ester is likely…

Q: how to determine the composition and pH of an ideal buffer solution using lactic acid

A: To determine the composition and pH of an ideal buffer solution using lactic acid, you need to…

Q: chemist dissolves 367. mg of pure barium hydroxide in enough water to make up 50. mL of solution.…

A:

Q: Sulfurous acid (H₂SO3) is a polyprotic acid. Write balanced chemical equations for the sequence of…

A: The given acid is an dibasic acid which can produce two H+ ions when dissolved in water.

Q: 25). What is the major organic product of the following reactions? H3C (A) (C) H₂C H3C- Br Mg in…

A: Aryl bromide react with Mg to give grignard reagent then react with CO2 to give acid then socl2 to…

Q: For the spectra below, predict which might be due to CO₂ and which SiO₂. Explain your answer. 0.8…

A: IR spectra is used to identify the functional groups of unknown organic compound and in the…

Q: amine reaction in bumetamide, not using an acid or base

A: Bumetamide is a loop diuretic that belongs to the sulfamyl category. It contains an amine group…

Q: OEt 4 3 0: تھ وسلم پہلی وسلم 5 2 OEt

A:

Coordination Chemistry

It is a part of chemistry, in which the study of compounds that have central atoms surrounded by molecules or ions, known as ligand, is known as coordination chemistry.