Phenol (hydroxybenzene) behaves as a weak acid.a) Write out the equilibrium equation for its partial dissociation in water.b) Write out the expression for the acid dissociation constant, Ka.d) Draw the conjugate base of phenol and show how it is stabilised by resonance.e) Compare and explain the acidity of phenol (p = 9.9) with that of:cyclohexanol (pk = 16.0)3-fluorophenol (pK₁ = 9.3)4-acetylphenol (pK, = 8.1)

Phenol (hydroxybenzene) behaves as a weak acid. a) Write out the equilibrium equation for its partial dissociation in water. b) Write out the expression for the acid dissociation constant, K₂. d) Draw the conjugate base of phenol and show how it is stabilised by resonance. e) Compare and explain the acidity of phenol (PK = 9.9) with that of: cyclohexanol (PK₁ = 16.0) 3-fluorophenol (p=9.3) 4-acetylphenol (p = 8.1)

Phenol (hydroxybenzene) behaves as a weak acid. a) Write out the equilibrium equation for its partial dissociation in water. b) Write out the expression for the acid dissociation constant, K₂. d) Draw the conjugate base of phenol and show how it is stabilised by resonance. e) Compare and explain the acidity of phenol (PK = 9.9) with that of: cyclohexanol (PK₁ = 16.0) 3-fluorophenol (p=9.3) 4-acetylphenol (p = 8.1)

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter22: Organic Chemistry

Section: Chapter Questions

Problem 60QAP: Write an equation for the reaction of chloroacetic acid (Ka=1.5103) with trimethylamine (Kb=5.9105)...

See similar textbooks

Similar questions

Compare and explain the acidity of phenol, ethanol, acetic acid. (Using pKa, structures of conjugate base)
4. The pk, of vanillin is about 9, which is much more acidic than a normal alcohol. Draw a reaction showing the deprotonation of vanillin with NaOH, and then draw six resonance structures of the conjugate base. Draw the hybrid structure and clearly indicate how the negative charge is distributed in the compound.
How does resonance affect the acidity of a compound? Why is phenol more acidic in some alcohols and why is carboxylic acid more acidic?
Arrange the following compounds in the increasing order of their acid strength: p-cresol, p-nitrophenol, phenol
propanoic acid + methanol (in concentrated sulfuric acid)
4-Methylphenol is more acidic than ethanol (pKa 10.36 vs 16.0) , even though both contain an OH group and a methyl group. Draw the structures of the anions formed from loss of the alcoholic protons from both compounds. Use resonance to explain the difference in their respective acidities.
Provide an explanation without using the pka values : Why is phenol stronger acid than butanoic acid?
Write the chemical equation for the acid dissociation of acetaminophen, C8H9O2N. Write the Ka expression for the acid dissociation of acetaminophen.
A carboxylic acid has two oxygen atoms, each with two nonbonding pairs of electrons.(a) Draw the resonance forms of a carboxylic acid that is protonated on the hydroxyoxygen atom.(b) Compare the resonance forms with those given previously for an acid protonated on thecarbonyl oxygen atom
Complete each acid-base reaction and predict whether the position of equilibrium lies toward the left or toward the right. (a) CH3CCH+CH3CH2ONa+CH3CH3OH (b) CH3CCCH2CH2OH+Na+NH2NH3(l)
Write an equation for the reaction of chloroacetic acid (Ka=1.5103) with trimethylamine (Kb=5.9105) . Calculate the equilibrium constant for the reaction. If 0.10 M solutions of these two species are mixed, what will be their concentrations at equilibrium?
11.27: Tell which is the stronger base and why? Aniline or p-cyanoaniline b) aniline or diphenylamine WH₂ |ال 11.30: Place the following substances, which have nearly identical formula weights, in order of increasing boiling point? 1-aminobutane, 1-butanol, methyl propyl ether, pentane