provide the complete equilibrium equations of the solubilizing of carbon dioxide gas in the air dissolved in rainwater and all species possible pH1 to pH 13. This means writing all species and each equilibrium equation that are present from pH 1 to 14.

Q: 1. If the weight of the pure recrystallized product (trans-anisalacetophenone) obtained is 166 mg,…

A: For question 1, we have to calculate the number of moles of pure product obtained from the given…

Q: 9. Which of the following covalent compounds share electrons via sp3 hybridization? Choose ALL that…

A: Note: Since you have asked multiple questions, we will solve the first question for you. If you want…

Q: 33. What are the expected products from the reaction shown? o (A) (B) (C) (D) -O-CH₂CH₂CH₂OH HBr…

A: In the given reaction ether reacts with hydrogen bromide to form an alcohol and alkyl bromide. In…

Q: II) a-Draw the proper Haworth form and most stable chair conformation for ß-anomer of…

A: Given structure

Q: Predict the product of the following chemical reaction: MgBr + Å OH A) 1. ether 2. H₂0¹ D) B) OH E)…

A: Epoxides under basic condition opens up from the less hindered side

Q: (e) Provide reagents/conditions and the order in which the reactions are carried out for the…

A: Given Reagents/Condition of protection = To be determined Order of protection = To be determined

Q: 10. The enthalpy of combustion for dodecane (MW: 170.34 g/mol) is -7902 kJ/mol. How much heat is…

A:

Q: how many moles of silicon is composed of 7.89 * 10^23 atoms of silicon?

A: Number of atoms of silicon = 7.89 ×1023 atomsmoles of silicon = ?Note: As we know that,6.022 × 1023…

Q: Calculate the heat required  to raise the temperature of a 50.0 g of water from 25.0 °C to 39.0 °C.…

A:

Q: The binding constants between the two amines shown and porphyrin monomer and dimer were measured in…

A: Stability of the chelating agent or compound is determined by the entropy, higher the chelation…

Q: transi O Лон H+ 1. 2. H3O+ 1. ? ONa Лон H+ 2. H3O+ с ONa НО

A: -> If acid present with nucleophile then epoxide ring opens towards most hindered site and.->…

Q: There are three sets of sketches below, showing the same pure molecular compound (ammonia, molecular…

A: Answer:Any matter can exist in any of the 3 physical states mentioned below:

Q: What is the correct common name for the compound shown here?

A: Determine the longest carbon chain with an amine functional group.To indicate the existence of an…

Q: How are the differences within a series of salt dilutions and between the two salts associated with…

A: The ionic strength of a solution quantifies the presence of ions within the solution. When ionic…

Q: (b) Provide the structure of the major products in the reactions below: (i) (ii) НО НО- НО OH НО НО…

A: Organic transformation

Q: 3. Calculate the number of moles of hydrofluoric acid, HF (K. = 6.8 x 104) that must be added to 500…

A: Given:Volume of 0.30 M sodium fluoride = 500 cm3 = 500 mL  ()Ka of HF = 6.8 x 10-4 pH of the…

Q: Consider a Galvanic cell constructed from the following half cells, linked by an external circuit…

A: Given: A galvanic cell is constructed from the following half-cells,an Al(s) electrode in 1.0 M…

Q: QUESTION 6 When the radioactive nucleus nucleus? a. 197 Rn b. 195, Bi O c. 199 Fr d. 197 Bi e. 203.…

A: Alpha particles is similar to the Helium nucleus. In other words it has 2 protons and 2 neutronsso…

Q: ▾ Standard deviation hint The average or mean, is defined by: where, each is the value of the data…

A: The average concentration of HCl solution is calculated using the following formula:

Q: What is the major organic product for the following reaction?

A: When the benzene reacts with an alkyl halide in the presence of a Lewis acid catalyst alkyl benzene…

Q: How many electrons are in bromine's (atomic number 35) next to outer shell (n=3)? 02 04 08 18

A:

Q: Please complete the following table. For each of your trials, enter the volume of commercial vinegar…

A: To determine the Molarity of acetic acid for each trial based on the given data.Average Molarity of…

Q: What is the IUPAC name for the following compound? عد Methyl 3-methylbutanamide N-Methyl…

A: Answer:IUPAC is the internation union of pure and applied chemistry. Some set of rules has been…

Q: What is the volume in L of 216.8 g of oxygen at 725 torr and 37° C

A: volume=V=?mass=m=216.8gtemperature=T=37 °C=310Kpressure=P=725 torrmolar mass of oxygen…

Q: CnH14O (triplet) 10 8 6 PPM 2 (doubet) 2 (triplet) 2 (sixtet) 2 3 (triplet) 0

A: The formula of the double bond equivalence is DBE = .The given molecular formula is C11H14O.So, the…

Q: For the following reaction, 0.553 moles of potassium hydroxide are mixed with 0.555 moles of…

A: Moles of KOH = 0.553 molesMoles of H3 = 0.555 moles

Q: 1. For a solution whose pH is 6.0, what is [H+]? If [H+] is 5 x 10-7 M, what is the pH? (answer =…

A: • For a solution,pH = 6.0[H+] = ?• For a solution, [H+] = 5 × 10-7 MpH = ?Note: The relationship…

Q: Solid barium fluoride has the same kind of crystal structure as CaF₂ which is pictured below: If the…

A: Solid barium fluoride has the same kind of crystal structure as CaF2Edge length of the unit cell =…

Q: What is the IUPAC name of the following compound? CH3CH₂CHC-H CH₂CH3

A: For naming of an organic molecule,Take the highest carbon containing carbon chain as parent or base…

Q: H₂N NH3+ COOH Arginine Lysine O Valine Proline

A: The given compound Chemical formula is.,COOHCH(NH2)CH2CH2CH2CH2NH3+

Q: What is the correct set of Starting Material that can complete this transformation

A: The Diels–Alder reaction is a pericyclic reaction (cycloaddition) between a conjugated diene and a…

Q: Draw the mechanism for the reaction please. xs CH3OH H3O+ H3CO OCH 3 H₂O

A:

Q: How many neutrons are needed to initiate the fission reaction? 235U+2n3Sr+¹34Xe +2 n 99

A: Answer:This question is based on the law of conservation of mass which states that total mass of…

Q: Which of the following compounds absorbs at the Longest Wavelength (Highest λmax)

A: Energy gap is inversely proportional to wavelength

Q: ? A) CH3Br, Pd-catalyst, Base B) CH₂l2, Zn(Cu) C) PhP=CH2 D) (CH3)2 CuLi

A:

Q: A hot-air balloon achieves its buoyant lift by heating the airinside the balloon, which makes it…

A:

Q: What is the name of the process by which a solute dissolves in a solvent? OA. Precipitation O B.…

A: A solute is a substance that is dissolved in a solvent (the medium) to form a solution.

Q: Consider the following half-reactions Cu+eCu E-+0.521 V H₂O₂ +2e H₂O E = +1.776 V Question 2 Which…

A:

Q: What is the ideal angle of the C-O-H bond? H3C. H 180° 90° 72⁰ 109.5° 120° H

A:

Q: (1.678x10^3m^2)/(1.6267x10^2m) ...I just need help with the sig figs and units

A: (1.678 X 103 m2 ) / (1.6267 X 102 m)Calculate the above problem with correct significant and unit.

Q: What is the molar mass of a gas whose density is 1.96 g/l at 0. ° C and 1.0 ATM

A: This is the question which is highlights the relationship between density of gas and it's molar mass…

Q: I) Draw a proper Fischer projection for the following molecule. Assign each stereogenic carbon as…

A:

Q: A solution is made by the following steps. 1. 90.0 mg ± 0.2 mg of dye with molar mass 685.79 g/mol ±…

A: "Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: Which reagents are best used to produce 4-methyl-2-pentanol from a ketone? a. amins and trace acid,…

A: In the given question we have to decide reagents which can be used to form a secondary alcohol from…

Q: What is the ratio of NH4+ to NO2- in O2-saturated water when the pH is 8.20 and the pE is 4.42?…

A:

Q: How many molecules are in 4.5558 g of Rh(SO4)? Answer

A: Number of moles iscalculated by dividing given mass with molecular mass.In the given question it has…

Q: EP1: Identify the hybridization state and geometry of each atom in the structure shown below: 'H…

A: Hybridization can be defined as the mixing of atomic orbitals to form a new orbital with similar…

Q: Which resonance structure results when the electrons are moved according to the curved arrow shown?…

A: When electrons are moved according to the curved arrow, the lone pair of electrons on the…

Q: Metallic niobium crystallizes in a body-centered cubic lattice, with one Nb atom per lattice point.…

A: Metallic niobium crystallizes in a body-centered cubic (BCC) lattice.Edge length (a) = 303 pmRadius…

Q: The specific heat capacity of a pure substance can be found by dividing the heat needed to change…

A: Given heat capacity of substance = Mass of substance = 383 gChange in temperature =