The equilibrium constant, Kc, for the following reaction is 57.6 at 277 K.2CH₂Cl₂ (g) CH4 (9) + CCl4 (9)When a sufficiently large sample of CH₂Cl₂ (g) is introduced into an evacuated vessel at 277 K, theequilibrium concentration of CC14 (g) is found to be 0.383 M.Calculate the concentration of CH₂Cl₂ in the equilibrium mixture.[CH₂Cl₂] =M The equilibrium constant, Kc, for the following reaction is 1.80 × 10NH4HS(s) NH3(g) + H₂S(9)at 298 K.Calculate the equilibrium concentration of H₂S when 0.525 moles of NH4HS(s) are introduced into a 1.00L vessel at 298 K.[H₂S] =M

Answer:For any reaction, value of equilibrium constant KC is equal to the ratio of molar…

The equilibrium constant, Kc, for the following reaction is 57.6 at 277 K. 2CH₂Cl2 (9) CH4 (9) + CCl4 (9) When a sufficiently large sample of CH₂Cl₂ (g) is introduced into an evacuated vessel at 277 K, the equilibrium concentration of CC14 (g) is found to be 0.383 M. Calculate the concentration of CH₂Cl2 in the equilibrium mixture. [CH₂ Cl₂] = M

The equilibrium constant, Kc, for the following reaction is 57.6 at 277 K. 2CH₂Cl2 (9) CH4 (9) + CCl4 (9) When a sufficiently large sample of CH₂Cl₂ (g) is introduced into an evacuated vessel at 277 K, the equilibrium concentration of CC14 (g) is found to be 0.383 M. Calculate the concentration of CH₂Cl2 in the equilibrium mixture. [CH₂ Cl₂] = M

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter12: Chemical Equilibrium

Section: Chapter Questions

Problem 60QRT

See similar textbooks

Similar questions

Suppose a reaction has the equilibrium constant K = 1.3 108. What does the magnitude of this constant tell you about the relative concentrations of products and reactants that will be present once equilibrium is reached? Is this reaction likely to be a good source of the products?
Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
Write a chemical equation for an equilibrium system that would lead to the following expressions (ad) for K. (a) K=(PH2S)2 (PO2)3(PSO2)2 (PH2O)2 (b) K=(PF2)1/2 (PI2)1/2PIF (c) K=[ Cl ]2(Pcl2)[ Br ]2 (d) K=(PNO)2 (PH2O)4 [ Cu2+ ]3[ NO3 ]2 [ H+ ]8
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
At room temperature, the equilibrium constant Kc for the reaction 2 NO(g) ⇌ N2(g) + O2(g) is 1.4 × 1030. Is this reaction product-favored or reactant-favored? Explain your answer. In the atmosphere at room temperature the concentration of N2 is 0.33 mol/L, and the concentration of O2 is about 25% of that value. Calculate the equilibrium concentration of NO in the atmosphere produced by the reaction of N2 and O2. How does this affect your answer to Question 11?
At 2300 K the equilibrium constant for the formation of NO(g) is 1.7 103. N2(g) + O2(g) 2 NO(g) (a) Analysis shows that the concentrations of N2 and O2 are both 0.25 M, and that of NO is 0.0042 M under certain conditions. Is the system at equilibrium? (b) If the system is not at equilibrium, in which direction does the reaction proceed? (c) When the system is at equilibrium, what are the equilibrium concentrations?
The decomposition of PCl5(g) to form PCl3(g) and Cl2(g) has Kc = 33.3 at a high temperature. If the initial concentration of PCl5 is 0.1000 M, what are the equilibrium concentrations of the reactants and products?
A 1.00-L flask was filled with 2.00 moles of gaseous SO2 and 2.00 moles of gaseous NO2 and heated. After equilibrium was reached, it was found that 1.30 moles of gaseous NO was present. Assume that the reaction SO2(g)+NO2(g)SO3(g)+NO(g) occurs under these conditions. Calculate the value of the equilibrium constant, K, for this reaction.
12.103 Methanol, CH3OH, can be produced by the reaction of CO with H2, with the liberation of heat. All species in the reaction are gaseous. What effect will each of the following have on the equilibrium concentration of CO? (a) Pressure is increased, (b) volume of the reaction container is decreased, (c) heat is added, (d) the concentration of CO is increased, (e) some methanol is removed from the container, and (f) H2 is added.