Q: Two sets of ionizations are shown in the tables below. Complete the tables by ordering each set of…
A: On moving from top to bottom in a group ionisation energy decreases becauseNumber of shell…
Q: The ions formed when Mgl2 dissociates in water are A) Mg²+ and 12- B) Mg²+ and I- C) Mg* and I D)…
A:
Q: hydrogen sulfide (H₂S) is usually extracted from 'sour' natural gas, it can also be produced…
A:
Q: 1. HgCl₂, H₂O 2. NaBH4
A:
Q: The following sugar is? ОН Но ОН Но ОН O A reducing sugar O Linked by an N-glycosidic bond O Derived…
A: Given,The sugar:
Q: Identify the major and minor product(s) of the following reaction: Br NaOEt ?
A: Alkyl halide reacts with strong bases to produce alkenes as the major products.
Q: What is the pH of a saturated solution of Fe(OH),? K,, -4.87×10 17 Be sure your answer has the…
A:
Q: 7 об (8) Н C он GH H30+ Н NaOH, H2O 25°C NQOH catalytic amount
A: The question is based on organic reactions.We need to identify the product and explain its…
Q: 1. Hg(OAc)₂, EtOH 2. NaBH4
A: Answer:Electrophilic addition reaction is the characteristic reaction of alkene where electrophile…
Q: Which of the following isomers is the most stable? O O O H..
A: Given are cyclohexane derivatives. The most stable cyclohexane is one that has more groups…
Q: Draw the product of the reaction shown below. Ignore inorganic byproducts. H₂ Raney Ni 'H
A: Raney Ni and H2 is a reducing agent, used to reduce aldehydes and ketones to alcohols.
Q: The gas phase decomposition of hydrogen iodide at 700 K HI(g) → ½ H₂ (9)+ ½ + ½/2 1₂ (9) is second…
A:
Q: How much precipitate will be recovered after excess CaCl₂ Hint: 1. Write out the balanced chemical…
A: The question Is based on the concept of reaction stoichiometry.we need to calculate mass of silver…
Q: CH3CH2OH Br
A: Nucleophilic substitution is a type of chemical reaction in which an electron-rich nucleophile…
Q: Draw a tiny section of a molecule of glycogen. Include 4 monomers. If there are any branch points in…
A: Given compound is Glycogen.Glycogen is polysaccharide madeup of several monosaccharide units.
Q: The reaction between aluminum and iron (III) oxide can generate temperatures approaching 3000°C and…
A: We will use the basic mole concept for the calculation. We will first determine the limiting reagent…
Q: 9F. Sketch the pi orbital overlap in the following molecules. (a) [OCN]- (one sketch each for 3…
A: To draw the pi-orbital overlap of the given molecules:a) OCN-b) CH2=CH-CH=CH2
Q: 3. Which of these two reactions would go better? Why? Br CH3CCH3 CH3 CH3CH₂CH₂Br NaN3 NaN3 N3 ->…
A: The question is based on the concept of organic reactions.We need to identify the reaction that…
Q: 3. Which of these two reactions would go better? Why? Br CH3CCH3 CH₁ CH₂CH₂CH₂Br NaN3 NaN3 N3…
A: The question is based on nucleophilic substitution reactions. We need to identify the better…
Q: 2. Show the reagent(s) necessary to carry out this reaction. NM₂ NH₂
A: The given reaction scheme is shown below.We have to provide the reagent of the given reaction.
Q: Draw the mirror image of the compound shown. OH дет OH OH H
A:
Q: A rigid cube (each side is 0.90 m) is filled with water and frozen solid. When water freezes its…
A:
Q: Draw the major product of this reaction. Ignore inorganic 1. NaNO2, H₂SO4 2. H₂O, Cu₂O, Cu(NO3)2 NH₂
A: Given reaction: An aniline and reagents NaNO2,H2SO4 and H2O, CuO, Cu(NO3)2we have to find the major…
Q: Carbon disulfide and oxygen react to form carbon dioxide and sulfur dioxide, like this: CS₂(g) +…
A:
Q: What absorbance value corresponds to 44.7% T? A = 0.357 A 0.0126 M solution of a certain analyte…
A: Information of question
Q: Write an equilibrium expression for each chemical equation involving one or more solid or liquid…
A: Equilibrium constant : Equilibrium constant (K) expresses the relationship between products and…
Q: Your pharmacy has on hand Robitussin CF Syrup (guaifenesin 100 mg/1 tsp). You receive a prescription…
A: Guaifenesin is a cough syrup that is taken to cure dry cough. And according to medical prescription…
Q: You want to adjust the pH of a liter of strong acid from 2.93 to 3.43. Part 1 of 2 Which ion must be…
A: The objective of the question is to calculate the moles of
Q: OH OH A) 2,3-dihydroxyhexane B) 2-hydroxy-3-hexanol C) 3-hydroxyl-2-hexanol D) hexane-2,3-diol E)…
A:
Q: The following data were measured in a 1.00-cm cell. Concentration (M) %T 14.9 26.1 38.0 54.3 65.7…
A: In the given question transmittance, concentration, and length of the cell are given and we have to…
Q: Consider the reaction. A(aq) 3 B(aq) If a 2.50 M sample of A is heated to 500 K, what is the…
A:
Q: Check the box under each compound that exists as a pair of mirror-image twins. If none of them do,…
A: The molecules with the same molecular formula but different structures are known as isomers. If the…
Q: Draw one of the two enantiomers of the major product from this reaction. Use a dash or wedge bond to…
A: In the above given reaction an alkene is treated with Br2 . This will lead to the formation of…
Q: Can someone explain what letter g is asking in relation to "k value", what exactly do they mean by…
A: This is based on le chatelier principle If the dynamic equilibrium is distributed by changing the…
Q: A solution containing 1.470 g of dichlorobenzene in 50.00 g of benzene boils at 80.60 degree C and a…
A:
Q: 1. 2. a = Electrophilic addition mot b = E2 Elimination c = SN1 Nucleophilic substitution 1. 2.…
A: In HBr, Br- act as a nucleophile generally used as a reagent in synthesize bromide compound.
Q: The equilibrium constant for the reaction NH3 (g) + HF (g) NH4F (S) at 25°C is 10.2. (a) If the…
A: Answer:For any reaction, value of equilibrium constant is equal to the ratio partial pressure of…
Q: 3. Which of these two reactions would go better? Why? N3 CH3CCH3 CH3 Br CH3CCH3 CH3 CH3CH₂CH₂Br NaN3…
A: The question is based on nucleophilic substitution reactions. We need to identify the better…
Q: Which statement best describes the structure that results from the following curved arrow: :0: [ε-1]…
A: Delocalization of electrons gives resonance structures which are called resonating structures. The…
Q: Determine the number of possible stereoisomers for the compound below. سليم CI Cl Number of…
A: Stereoisomerismthe isomerism that is caused by the non-similar arrangements of atoms or functional…
Q: 2. Show the reagent(s) necessary to carry out this reaction. ہے۔ ہر۔ CH₂
A: The given synthesis scheme is shown below.We have to provide the reagents required for this…
Q: 1. BH3/THF 2. H₂O₂/OH™
A: In the hydroboration-oxidation of alkynes, the addition of water to alkynes takes place according to…
Q: 30. An enzyme was obtained in Dr. Cai's lab. To study the kinetics of this enzyme, a graduate…
A: [S] = 0.1mMKI = 1.5 mMKm = 0.2 mM
Q: Draw one of the two enantiomers of the major product from this reaction. Use a dash or wedge bond to…
A: In the reaction the double bond first attacks the Cl2 to produce a three-membered chloronium ion…
Q: Write a Lewis structure that obeys the octet rule for each molecule or ion. Include resonance…
A: Lewis structure and octate rule
Q: Resonance Inductive down Element base left-to-right Hybidization conjugate base up conjugate acid…
A: Acids (H-A) when dissolved in water dissociate to form H+ and A- ions. The strength of an acid can…
Q: What reagent(s) will best complete the following reaction? HONO, HCI I N₂ NaOH = H₂O, Cu₂O Cu(NO3)2…
A:
Q: Predict the major product(s) of the following reactions. For reactions that are not stereospecific,…
A: Given that, the reaction is:
Q: The bond angles marked a, b, and c in the molecule below are about H-N-C-CC-O-H Ic H O 109.5°, 120°,…
A: The bond angle is the angle between two adjacent bonds in a molecule. The bond angle affects the…
Q: Calculate AS for the following reaction: 2CH₂OH()+30₂ (→ 2CO₂ (s) + 4H₂O (@ Report your answer to…
A: Entropy of a system is defined as the statistical number of microstates or degrees of freedom…
Give detailed Solution with explanation needed of all options..don't give Handwritten answer
Step by step
Solved in 3 steps with 1 images
- 1. Draw the carboxylic acids formed by the oxidation of each of the following molecules. HOH₂C H2 CH3 H3CH2C H + 2. Draw the esters formed by the following reactions. a. H3C H3C-C-C H₂ H3C. OH H3C OH b. H3C H3CHCH2CH2C- རི OH + H3C. `CH2CH3 OH H₂ 3. Indicate the products of the following reaction: LCH CH3 + H₂O H3CH2CH2C CH₂OHWhat are the products of the reaction between acetyl chloride and diethylamine? HCl and N,N-diethylacetamide Оа. o b. HCl and diethylamine chloride ос. HCl and N-ethylacetamide d. Diethylacetamide and acidAcid anhydride Carboxylic Acid H₂C CH₂OH H₂O CH,OH CH3 Ester H₂C O CH₂OH 1. CH₂MgBr 2. H₂O* Acid chloride CH,CH,NH, Tertiary alcohol Amide
- What is the name of the major product formed during the reaction between berzoyl chloride and phenol? a. phenyl benzoate b. benzyl ester C. cyclopentanoate d. benzyl phenoate e. benzenecarboxylic acid O a O b O c e3. Amidation is a reaction similar to esterification, except an amine is added to the carboxylic acid instead of an alcohol, producing an amide. Using the pattern you have learned from esterification (and information in your textbook), complete the chemical equation for the following amidation reaction: O heat CH3 CH2 NH2 HO-C- CH2- CH3Which of the following carbonyl compounds is the least reactive? O A. Acid halide O B. anhydride O C. ester O D. amide
- 7. Strong base is added to the following structure/solution until the reaction is complete. Predict the odor of the NEW product formed /after the reaction has reached completion. Give the name of the reaction. H. H-C-C H. OH OA Sweet smelling Esterification OB. Unpleasant smell; Acid hydrolysis OC Pungent odor; Reduction of carboxylic acids O D. No odor, NeutralizationName: 2) When water is introduced into an ester under high temperature conditions, esters are hydrolyzed into their carboxylic acid and alcohol components. Draw the structure of the resulting carboxylic acid and alcohol when the ester shown below is hydrolyzed. + H20 3) Why is it important that the test tube be thoroughly dry before making esters? Use the principles of chemical equilibrium to explain your answer.I. Complete the table. Classification of Carboxylic Acids and its derivatives No. Common Name Structure IUPAC Name 1. CH3CH2CH2COONA COOH(CH2)SCOOH 3. CH3CH2CH2CH2CH2COOH 4. C6HSCOOCOC6H5 5. CICOCH2CH2CH2CH2OH 6. CH3(CH2)7CONH2 7. CH3(CH2)3CH2COOCH2(CH2).CH3 CH3CH2OCOCH2CH2CH2CH2CH2CH2 8. CH3 9. CH3CH2CH2CH2CH2CH2CH2CH2COCI 10. H2NCOCH2CH2CH2CH3 2.