X Incorrect.Write a balanced equation for the formation reaction of each of the following substances:Edit(a) K3PO4(s)Н РО, (1) + зко, ()-к,РО, + ЗН,О(b) acetic acid, CH3CO2H(I)2C(graphite) + 2H,(g) + 0,(g)→CH,CO04(1)(c) trimethylamine, (CH3)3N(g)3CH,0,(1) + NH, (g)→(CH,),N(g)+3H,O(d) bauxite, Al203(s)4Al + 30,–2Al,03eTextbook and MediaSave for LaterAttempts: 1 of 3 usedSubmit Answer

Answered: Image /qna-images/answer/ed143fb0-9152-4653-9e34-b9a3ee3a1d6d.jpg

Write a balanced equation for the formation reaction of each of the following substances: (a) K3PO4(s) Н, РО, (1) + зко, (1)-К, РО, + ЗН,0 (b) acetic acid, CH3CO2H(1) 2C(graphite) + 2H, (g) + O,(g)→CH,COO4(1) (c) trimethylamine, (CH3)3N(g) 3CH,0,(1) + NH,(g)→(CH,),N(g) + 3H,0 (d) bauxite, Al203(s) 4Al + 30,=2Al,O,3

Write a balanced equation for the formation reaction of each of the following substances: (a) K3PO4(s) Н, РО, (1) + зко, (1)-К, РО, + ЗН,0 (b) acetic acid, CH3CO2H(1) 2C(graphite) + 2H, (g) + O,(g)→CH,COO4(1) (c) trimethylamine, (CH3)3N(g) 3CH,0,(1) + NH,(g)→(CH,),N(g) + 3H,0 (d) bauxite, Al203(s) 4Al + 30,=2Al,O,3

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter9: Energy And Chemistry

Section: Chapter Questions

Problem 9.52PAE: 9.52 Write the formation reaction for each of the following substances. (a) CH4(g) , (b) C3H(l) ,...

See similar textbooks

Similar questions

Use the appropriate tables to calculate H for (a) the reaction between copper(II) oxide and carbon monoxide to give copper metal and carbon dioxide. (b) the decomposition of one mole of methyl alcohol (CH3OH) to methane and oxygen gases.
A reaction used to produce the silicon for semiconductors from sand (SiO2), can be broken up into three steps: SiO2(s)+2C(s)Si(s)+2CO(g)H=689.9kJ Si(s)+2Cl2(s)SiCl4(g)H=657.0kJ SiCl4(g)+2Mg(s)2MgCl2(g)+Si(s)H=625.6kJ (a) Write a thermochemical equation for the overall reaction where silicon is obtained from silicon dioxide and CO and MgCl2 are by-products. (b) What is H for the formation of one mole of silicon? (c) Is the overall reaction exothermic?
Three reactions very important to the semiconductor industry are The reduction of silicon dioxide to crude silicon, SiO2(s) + 2 C(s) → Si(s) + 2 CO(g) ΔrH° = 689.9 kJ/mol The formation of silicon tetrachloride from crude silicon, Si(s) + 2 Cl2(g) → SiCl4(g) ΔrH° = −657.01 kJ/mol The reduction of silicon tetrachloride to pure silicon with magnesium, SiCl4(g) + 2 Mg(s) → 2 MgCl2(s) + Si(s) ΔrH° = −625.6 kJ/mol Calculate the overall enthalpy change when 1.00 mol sand, SiO2, changes into very pure silicon by this series of reactions.
How much heat is produced when 1.25 g of chromium meta’ reacts with oxygen gas under standard conditions?
What is Hrxn for reaction of iron(III) oxide and carbon monoxide to give iron metal and carbon dioxide gas? Use the following reactions: 4Fe(s)+3O2(g)2Fe2O3(s)H=1648.4kJ4CO(g)+O2(g)2CO3(g)H=565.98kJ
9.52 Write the formation reaction for each of the following substances. (a) CH4(g) , (b) C3H(l) , (c) HCI(g), (d) C6H12O6(s) , (e) NaF(s)
Oxygen is not normally found in positive oxidation states, but when it is combined with fluorine in the compound oxygen difluoride, oxygen is in a +2 oxidation state. Oxygen difluoride is a strong oxidizing agent that oxidizes water to produce O2 and HF. OF2(g) + H2O(g) → 2 HF(g) + O2(g) The standard formation enthalpy of oxygen difluoride is 24.5 kJ/mol. Using this information and data from Appendix J, calculate the standard reaction enthalpy for the reaction of oxygen difluoride with water. Table 4.2 Selected Standard Formation Enthalpies, ΔfH°, at 25°C
Data are given in Appendix 1 for white phosphorus, P4(s). P4(g) has the following thermodynamic values: Hf=58.9kJ/mol , S=280.0J/kmol . What is the temperature at which white phosphorus sublimes at 1 atm pressure?
Actually, the carbon in CO2(g) is thermodynamically unstable with respect to the carbon in calcium carbonate(limestone). Verify this by determining the standardGibbs free energy change for the reaction of lime,CaO(s), with CO2(g) to make CaCO3(s).
Calcium carbide, CaC2, is manufactured by reducing lime with carbon at high temperature. (The carbide is used in turn to make acetylene, an industrially important organic chemical.) Is the reaction endothermic or exothermic?
The reaction of quicklime, CaO, with water produces slaked lime, Ca(OH)2, which is widely used in the construction industry to make mortar and plaster. The reaction of quicklime and water is highly exothermic: CaO(s)+H2O(l)Ca(OH)2(s)H=350kJmol1 (a) What is the enthalpy of reaction per gram of quicklime that reacts?. (b) How much heat, in kilojoules, is associated with the production of 1 ton of slaked lime?
How many kilojoules of heat will be released when exactly 1 mole of manganese, Mn, is burned to form Mn3O4(s) at standard state conditions?