Write the balanced NET ionic equation for the reaction when (NH,),CO, and CaCl, are mixed in aqueous solution. If no reaction occurs, simply write only NR.
Q: Write the balanced NET ionic equation for the reaction when Pb(NO3)2 and Kl are mixed in aqueous…
A: The Reaction between Lead Nitrate and Potassium iodide. Pb(NO3)2(aq)+KI(aq) ---------->…
Q: Aqueous solutions of water-soluble AgNO, and Fel, are mixed, forming a dark-yellow precipitate. c.…
A: Please find the solution attached.
Q: Write the balanced COMPLETE ionic equation for the reaction when aqueous NiCl₂ and aqueous Na₂S are…
A: The reactants given are, 1) NiCl2 (aq) 2) Na2S (aq) And the products forming are, 1) NiS (s) 2)…
Q: Write the balanced COMPLETE ionic equation for the reaction when KI and AgNO₃ are mixed in aqueous…
A: The ionic equation represents the dissociated ions.
Q: A sample of 0.3220 g of an ionic compound containing the bromide ion (Br-) is dissolved in water and…
A: Given mass of sample=0.3220 gMass of AgBr precipitated=0.694 g% by mass of Br in sample=?
Q: Give the net ionic equation for the reaction (if any) that occurs when aqueous solutions of MgSO3…
A: When solutions of magnesium sulfite (MgSO3) and hydrogen iodide (HI) are mixed, a double…
Q: Write the balanced COMPLETE ionic equation for the reaction when (NH₄)₃PO₄ and Na₂SO₄ are mixed in…
A: Writing the balanced chemical equation meuld be:2(NH4)3 Po4 + 3 Na2 So4 ⇌3(NH4) so4 + 2 Na3PO4
Q: Write the balanced COMPLETE ionic equation for the reaction when ZnCl, and KOH are mixed in aqueous…
A:
Q: Write the balanced NET ionic equation for the reaction when Al(NO₃)₃ and NaOH are mixed in aqueous…
A: The balanced chemical equation is -
Q: Write the balanced COMPLETE ionic equation for the reaction when Cs₃PO₄ and AgNO₃ are mixed in…
A: balanced equation for Cs₃PO₄ and AgNO₃ : Cs₃PO₄ + 3AgNO₃ -------> Ag3PO4 (s) + 3CsNO3 complete…
Q: Write the balanced NET ionic equation for the reaction when Na₂S and NiSO₄ are mixed in aqueous…
A: Given Reactant = Na2S and NiSO4 Balanced net ionic equation = ?
Q: Write the balanced COMPLETE ionic equation for the reaction when KI and AGNO3 are mixed in aqueous…
A: The following are the solubility rules for common ionic solids : Salts containing Group I elements…
Q: When the following equation is balanced properly under basic conditions, what are the coefficients…
A:
Q: Chlorine can be prepared in the la escribed by the chemical equatic MnO, (s) + 4 HCI(aq) - ow much…
A:
Q: Write the balanced COMPLETE ionic equation for the reaction when aqueous CS3PO4 and aqueous AGNOS…
A: we will write the ions involved in every species present Cs3PO4(aq)--> 3 Cs+3 (aq)+PO3-4(aq)…
Q: Write the balanced NET ionic equation for the reaction when Pb(NO₃)₂ and RbCl are mixed in aqueous…
A: Net ionic equation is the chemical equation that shows ions that are directly involved in the…
Q: 3. Write the balanced chemical equations for the reaction of CaCl, with Na,CO, (molecular and net…
A: Balance chemical equation: Balance chemical equation can be define as a reaction in which number of…
Q: Write the balanced COMPLETE ionic equation for the reaction when (NH₄)₃PO₄ and Na₂SO₄ are mixed in…
A: Given The given ionic compounds are (NH4)3PO4 and Na2SO4.
Q: Write the balanced COMPLETE ionic equation for the reaction when aqueous BaCI, and aqueous…
A: Given :- BaCl2(aq) + (NH4)2SO4(aq) ----> NH4cl(aq) + BaSO4(s) To write :- complete ionic…
Q: Write the balanced NET ionic equation for the reaction when silver perchlorate and aluminum chloride…
A: Given : Reaction between Silver Perchlorate and Aluminum Chloride To find : Balanced net ionic…
Q: Write the balanced NET ionic equation for the reaction when ammonium bromide and lead(II) acetate…
A: Given that , Ammonium bromide reacts with lead(II) acetate. We have to balance the net ionic…
Q: Write the net ionic reaction for the reaction of a barium ion with a sulfate ion under aqueous…
A: The net ionic equation can be written as:
Q: Write the balanced COMPLETE ionic equation for the reaction when lead(II) acetate and hydrochloric…
A: The balanced molecular reaction taking place is Pb(CH3COO)2 (aq) + 2 HCl (aq) ----> PbCl2 (s) +…
Q: Write the balanced COMPLETE ionic equation for the reaction when FeC₂H₃O₂ and Ca(OH)₂ are mixed in…
A: Aqueous solution of Fe(C₂H₃O₂)₂ and Aqueous solution of Ca(OH)₂ are mixed together to give Fe(OH)₂…
Q: Decomposition Reactions: Complete and balance: КОН AICI; Na,CO,
A: In decomposition reactions, one compound decomposes into two or more compounds or atoms.
Q: Write the balanced NET ionic equation for the reaction when NH₄Cl and K₂S are mixed in aqueous…
A: the species mainly involved in reaction is depicted by net ionic equation
Q: Write the balanced NET ionic equation for the reaction when Na₂S and ZnCl₂ are mixed in aqueous…
A: The net ionic equation is used to represent only those species i.e. ions and molecules that…
Q: Write the balanced NET ionic equation for the reaction when AICI3 and NazS are mixed in aqueous…
A: Write the balanced molecular equation Split electrolytes to their corresponding ions to achieve…
Q: Write the balanced NET ionic equation for the reaction when aqueous BaCl, and aqueous (NH4)2SO4 are…
A: A net ionic equation is an equation where spectator ions are removed. It consists of the ions which…
Q: Write the balnced NET ionic equation for the reaction when Na2S and NiSO4 are mixed in aqueous…
A:
Q: Write the balanced NET ionic equation for the reaction when (NH4)»CO3 and CaCl2 are mixed in aqueous…
A: Ammonium carbonate reacts with calcium chloride to give ammonium chloride and precipitate of calcium…
Q: Write the balanced COMPLETE ionic equation for the reaction when Fe(NO3)3 and NaOH are mixed in…
A: The reactants given are iron (III) nitrate i.e. Fe(NO3)3 and sodium hydroxide i.e. NaOH.
Q: Write a net ionic equation for the reaction that occurs when barium sulfite (s) and excess nitric…
A: The net ionic equation is written when the ions participating in the reaction are written. The…
Q: If HCl and CuSO4 solutions were mixed, would a reaction occur? If so, what is the equation?
A:
Q: Write the balanced NET ionic equation for the reaction when HNO: and CSOH are mixed in aqueous…
A: A double displacement reaction (also called double replacement) is a reaction in which ions of two…
Q: Write the balanced COMPLETE ionic equation for the reaction when aqueous NICI, and aqueous Na,S are…
A: According to the question NiCl2 reacts with Na2S to form NiS and NaCl. Molecular equation : NiCl2…
Q: Aqueous solutions of water-soluble AgNO3 and Fel, are mixed, forming a dark-yellow precipitate. a.…
A: During the reaction following Product is formed a) Dark yellow precipate of AgI is obtained .
Q: Write the balanced COMPLETE ionic equation for the reaction when Na:COs and A9NO3 are mixed in…
A:
Q: Write the balanced COMPLETE ionic equation for the reaction when Na:COs and AGNO3 are mixed in…
A: The given compounds are: Na2CO3 - Sodium carbonate AgNO3 - Silver nitrate
Q: The constant balance for this reaction: PH3BC13(s) PH3(g) + BCI3(g) Is K=
A: Constant balance is the equilibrium constant(Keq), which is the ratio of the concentration of…
Q: A sample of solid sodium hydroxide, weighing 13.20 grams, is dissolved in deionized water to make a…
A:
Q: Write the balanced NET ionic equation for the reaction when NaOH and FeCl₂ are mixed in an aqueous…
A: Aqueous ferrous chloride (FeCl2) reacts with aqueous sodium hydroxide NaOH to produce ferrous…
Q: Write the balanced COMPLETE ionic equation for the reaction when Kl and AGNO, are mixed in aqueous…
A: In a chemical reaction; the substance which involves in conversion is said to be reactant whereas…
Q: Write the balanced NET ionic equation for the reaction when aqueous BaCl, and aqueous (NH4)2SO4 are…
A: Steps to write Net ionic equation- Write balanced reaction. Write ions of each aqueous species.…
Q: Write the balanced NET ionic equation for the reaction when Pb(N03)2 and KI are mixed in aqueous…
A: The molecular equation taking place is as follows: Pb(NO3)2(aq)+2KI(aq)→PbI2(s)+2KNO3(aq)
Q: Write the balanced NET ionic equation for the reaction when aqueous BaCl and aqueous (NH4)2SO4 are…
A: The reaction in which the number of atoms on both sides of the reaction is the same is called the…
Q: Write the balanced molecular chemical equation for the reaction in aqueous solution for copper(I)…
A:
Q: Write the balanced COMPLETE ionic equation for the reaction when aqueous NiCb and aqueous Na»S are…
A: The balanced complete ionic equation for the reaction when aqueous NiCl2 and aqueous Na2S are mixed…
Step by step
Solved in 4 steps
- One of the few industrial-scale processes that produce organic compounds electrochemically is used by the Monsanto Company to produce1,4-dicyanobutane. The reduction reaction is 2CH2CHCH+2H++2eNC(CH2)4CN The NC(CH2)4CN is then chemically reduced using hydrogen gas to H2N(CH2)6NH2, which is used in the production of nylon. What current must be used to produce 150.kg NC(CH2)4CN per hour?A chemist dissolves a 1.497-g sample of a type of metal (an alloy of Sn, Pb, Sb, and Cu) in nitric acid, and metastannic acid, H2SnO3, is precipitated. She heats the precipitate to drive off the water, which leaves 0.4909 g of tin(IV) oxide. What was the percentage of [in in the original sample?Ten mL of concentrated H3PO4 (91.7% by mass, d=1.69g/mL) was accidentally poured into a beaker containing 20.0 g of NaOH. Not all the NaOH was consumed. How many grams of NaOH were left unreacted? The equation for the reaction is H3PO4(aq)+3OH(aq)3H2O+PO43(aq)
- Magnesium metal (a component of alloys used in aircraft and a reducing agent used in the production of uranium, titanium, and other active metals) is isolated from sea water by the following sequence of reactions: Mg2+(aq)+Ca(OH)2(aq)Mg(OH)2(s)+Ca2+(aq)Mg(OH)2(s)+2HCl(aq)MgCl2(s)+2H2O(l)MgCl2(l)electrolysisMg(s)+Cl2+Cl2(g) Sea water has a density of 1.026 g/cm3 and contains 1272 parts per million of magnesium a5 Mg2+(aq) by mass. What mass, in kilograms, of Ca(OH)2; is required to precipitate 99.9% of the magnesium in 1.00103 L of sea water?Sodium bicarbonate (baking soda), NaHCO3, can be purified by dissolving it in hot water (60 C), filtering to remove insoluble impurities, cooling to 0 C to precipitate solid NaHCO3, and then filtering to remove the solid, leaving soluble impurities in solution. Any NaHCO3 that remains in solution is not recovered. The solubility of NaHCO3 in hot water of 60 C is 164 g/L. Its solubility in cold water of 0 C is 69 g/L. What is the percent yield of NaHCO3 when ills purified by this method?When jump-starting a car with a dead battery, the ground jumper should be attached to a remote part of the engine block. Why?
- Cobalt metal can be prepared by reducing cobalt (II) oxide with carbon monoxide. CoO(s)+CO(g)Co(s)+CO2(g)Kc=4.90102 at 550 COn Easter Sunday, April 3, 1983, nitric acid spilled from a tank car near downtown Denver, Colorado. The spill was neutralized with sodium carbonate: 2HNO3(aq)+Na2CO3(aq)2NaNO3(aq)+H2O(l)+CO2(g) a. Calculate H for this reaction. Approximately 2.0 104 gal nitric acid was spilled. Assume that the acid was an aqueous solution containing 70.0% HNO3 by mass with a density of 1.42 glcm3. What mass of sodium carbonate was required for complete neutralization of the spill, and what quantity of heat was evolved? (Hf for NaNO3(aq) = 467 kJ/mol) b. According to The Denver Post for April 4, 1983, authorities feared that dangerous air pollution might occur during the neutralization. Considering the magnitude of H, what was their major concern?Joseph Priestly prepared oxygen in 1774 by heating red mercury(II) oxide with sunlight focused through a lens. How much heat is required to decompose exactly 1 mole of red HgO(s) to Hg(l) and O2(g) under standard conditions?
- Gold is produced electrochemically from an aqueous solution of Au(CN)2 containing an excess of CN. Gold metal and oxygen gas are produced at the electrodes. What amount (moles) of O2 will be produced during the production of 1.00 mole of gold?The carbon dioxide exhaled in the breath of astronauts is often removed from the spacecraft by reaction with lithium hydroxide 2LiOH(s)+CO2(g)Li2CO3(s)+H2O(l) Estimate the grams of lithium hydroxide required per astronaut per day. Assume that each astronaut requires 2.50 103 kcal of energy per day. Further assume that this energy can be equated to the heat of combustion of a quantity of glucose, C6H12O6, to CO2(g) and H2O(l). From the amount of glucose required to give 2.50 103 kcal of heat, calculate the amount of CO2 produced and hence the amount of LiOH required. The H for glucose(s) is 1273 kJ/mol.Ethanol, C2H5OH, is a gasoline additive that can be produced by fermentation of glucose. C6H12O62C2H5OH+2CO2 (a) Calculate the mass (g) of ethanol produced by the fermentation of 1.000 lb glucose. (b) Gasohol is a mixture of 10.00 mL ethanol per 90.00 mL gasoline. Calculate the mass (in g) of glucose required to produce the ethanol in 1.00 gal gasohol. Density of ethanol = 0.785 g/mL. (c) By 2022, the U. S. Energy Independence and Security Act calls for annual production of 3.6 1010 gal of ethanol, no more than 40% of it produced by fermentation of corn. Fermentation of 1 ton (2.2 103 lb) of corn yields approximately 106 gal of ethanol. The average corn yield in the United States is about 2.1 105 lb per 1.0 105 m2. Calculate the acreage (in m2) required to raise corn solely for ethanol production in 2022 in the United States.