2,6 A rhodium metal centre undergoes cyclometallation with two units of C=C, what is the expected product of this reaction?O A. 5-membered rhodacycle ring is formedO B. 6-membered rhodacycle ring is formedO C. the two units of C=C are reduced to alkane C-C bond.O D. the two units of C=C are inserted to the rhodium metal centre Why can an organometallic complex perform the reactions such as insertion where normal coordination complex could not perform?O A. Because of the intramolecular pi-electron charge transfer in the ligand.OB.Because of the intermolecular pi-electron charge transfer in the ligand.Because the presence of dorbitals in the metal centre.O D. Because of the metal to ligand pi-electron charge transfer.

Correct choice is option ( A) 5 membered rhodacycle ring is formed.

A rhodium metal centre undergoes cyclometallation with two units of C=C, what is the expected product of this reaction? O A. 5-membered rhodacycle ring is formed O B. 6-membered rhodacycle ring is formed O C. the two units of C=C are reduced to alkane C-C bond. O D. the two units of C=C are inserted to the rhodium metal centre

A rhodium metal centre undergoes cyclometallation with two units of C=C, what is the expected product of this reaction? O A. 5-membered rhodacycle ring is formed O B. 6-membered rhodacycle ring is formed O C. the two units of C=C are reduced to alkane C-C bond. O D. the two units of C=C are inserted to the rhodium metal centre

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter21: Transition Metals And Coordination Chemistry

Section: Chapter Questions

Problem 8RQ

See similar textbooks

Similar questions

Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
The square-planar complex Pt(en)Cl2 has chloride ligands in a cis configuration. No trans isomer is known. Based on the bond lengths and bond angles of carbon and nitrogen in the ethylenediamine ligand, explain why the trans compound is not possible.
The transition metals form a class of compounds called metal carbonyls, an example of which is the tetrahedral complex Ni(CO)4. Given the following thermodynamic data (at 298 K): (a) Calculate the equilibrium constant for the formation of Ni(CO)4(g) from nickel metal and CO gas. (b) Is the reaction of Ni(s) and CO(g) product- or reactant-favored at equilibrium? (c) Is the reaction more or less product-favored at higher temperatures? How could this reaction be used in the purification of nickel metal?