Principles of General Chemistry
3rd Edition
ISBN: 9780073402697
Author: SILBERBERG, Martin S.
Publisher: McGraw-Hill College
expand_more
expand_more
format_list_bulleted
Concept explainers
Question
Chapter 3, Problem 3.54P
Interpretation Introduction
Interpretation:Mass of
Concept introduction: The formula to convert mass in grams to moles is as follows:
For some stoichiometric balanced equation; the reactant present in the smallest amount is consumed completely to form the product and thus governs the product formation.This reactant is known as limiting reactant.On the basis of the stoichiometric ratio by which substrates combine, moles of product formed from each reactant can be calculated.
Expert Solution & Answer
Want to see the full answer?
Check out a sample textbook solutionChapter 3 Solutions
Principles of General Chemistry
Ch. 3 - The atomic mass of Cl is 35.45 amu, and the atomic...Ch. 3 - (a) How many moles of C atoms are in 1 mol of...Ch. 3 - Prob. 3.3PCh. 3 - How is the molecular mass of a compound the same...Ch. 3 - What advantage is there to using a counting unit...Ch. 3 - Prob. 3.6PCh. 3 - Prob. 3.7PCh. 3 - Calculate the molar mass of each of the following:...Ch. 3 - Prob. 3.9PCh. 3 - Calculate the molar mass of each of the following:...
Ch. 3 - Prob. 3.11PCh. 3 - Calculate each of the following quantities: (a)...Ch. 3 - Prob. 3.13PCh. 3 - Prob. 3.14PCh. 3 - Prob. 3.15PCh. 3 - Calculate each of the following quantities: (a)...Ch. 3 - Calculate each of the following: Mass % of H in...Ch. 3 - Prob. 3.18PCh. 3 - Prob. 3.19PCh. 3 - Prob. 3.20PCh. 3 - Prob. 3.21PCh. 3 - Prob. 3.22PCh. 3 - Prob. 3.23PCh. 3 - Which of the following sets of information allows...Ch. 3 - What is the empirical formula and empirical...Ch. 3 - Prob. 3.26PCh. 3 - Prob. 3.27PCh. 3 - Prob. 3.28PCh. 3 - Prob. 3.29PCh. 3 - Prob. 3.30PCh. 3 - Prob. 3.31PCh. 3 - Prob. 3.32PCh. 3 - Cortisol (m=362.47g/mol) is a steroid hormone...Ch. 3 - Prob. 3.34PCh. 3 - Prob. 3.35PCh. 3 - Prob. 3.36PCh. 3 - Write balanced equations for each of the following...Ch. 3 - Write balanced equations for each of the following...Ch. 3 - Prob. 3.39PCh. 3 - Prob. 3.40PCh. 3 - Prob. 3.41PCh. 3 - Potassium nitrate decomposes on heating, producing...Ch. 3 - Prob. 3.43PCh. 3 - Calculate the mass of each product formed when...Ch. 3 - Prob. 3.45PCh. 3 - Prob. 3.46PCh. 3 - Prob. 3.47PCh. 3 - Many metals react with oxygen gas to form the...Ch. 3 - Prob. 3.49PCh. 3 - Calculate the maximum numbers of moles and grams...Ch. 3 - Prob. 3.51PCh. 3 - Prob. 3.52PCh. 3 - Prob. 3.53PCh. 3 - Prob. 3.54PCh. 3 - Prob. 3.55PCh. 3 - Prob. 3.56PCh. 3 - Prob. 3.57PCh. 3 - Prob. 3.58PCh. 3 - Prob. 3.59PCh. 3 - Prob. 3.60PCh. 3 - Prob. 3.61PCh. 3 - Prob. 3.62PCh. 3 - Prob. 3.63PCh. 3 - Prob. 3.64PCh. 3 - Prob. 3.65PCh. 3 - Six different aqueous solutions (with solvent...Ch. 3 - Prob. 3.67PCh. 3 - Prob. 3.68PCh. 3 - Prob. 3.69PCh. 3 - Calculate each of the following quantities: (a)...Ch. 3 - Prob. 3.71PCh. 3 - Prob. 3.72PCh. 3 - Prob. 3.73PCh. 3 - Prob. 3.74PCh. 3 - Prob. 3.75PCh. 3 - Prob. 3.76PCh. 3 - Prob. 3.77PCh. 3 - Prob. 3.78PCh. 3 - Prob. 3.79PCh. 3 - Prob. 3.80PCh. 3 - Prob. 3.81PCh. 3 - Prob. 3.82PCh. 3 - Prob. 3.83PCh. 3 - Prob. 3.84PCh. 3 - Prob. 3.85PCh. 3 - Seawater is approximately 4.0% by mass dissolved...Ch. 3 - Is each of the following statements true or false?...Ch. 3 - Prob. 3.88PCh. 3 - In each pair, choose the larger of the indicated...Ch. 3 - Prob. 3.90PCh. 3 - Prob. 3.91PCh. 3 - Assuming that the volumes are additive, what is...Ch. 3 - Prob. 3.93PCh. 3 - Prob. 3.94PCh. 3 - Hydrocarbon mixtures are used as fuels, (a) How...Ch. 3 - Prob. 3.96PCh. 3 - Prob. 3.97PCh. 3 - Prob. 3.98PCh. 3 - Prob. 3.99PCh. 3 - Write a balanced equation for the reaction...Ch. 3 - Prob. 3.101PCh. 3 - Citric acid (right) is concentrated in citrus...Ch. 3 - Prob. 3.103PCh. 3 - Prob. 3.104PCh. 3 - Prob. 3.105PCh. 3 - Prob. 3.106PCh. 3 - Aspirin (acetylsalicylic acid, C9H8O4 ) is made by...Ch. 3 - Prob. 3.108PCh. 3 - Prob. 3.109PCh. 3 - Prob. 3.110PCh. 3 - High-temperature superconducting oxides hold great...
Knowledge Booster
Learn more about
Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.Similar questions
- For the chemical reaction C3H8O2+4O23CO2+4H2O how many product molecules are formed when nine C3H8O2 molecules react?arrow_forwardThe following quantities are placed in a container: 1.51024 atoms of hydrogen, 1.0 mol of sulfur, and 88.0 g of diatomic oxygen. What is the total mass in grams for the collection of all three elements? What is the total number of moles of atoms for the three elements? If the mixture of the three elements formed a compound with molecules that contain two hydrogen atoms, one sulfur atom, and four oxygen atoms, which substance is consumed first? How many atoms of each remaining element would remain unreacted in the change described in (c)?arrow_forwardYou know that chemical A reacts with chemical B. You react 10.0 g A with 10.0 g B. What information do you need to determine the amount of product that will be produced? Explain.arrow_forward
- A potential fuel for rockets is a combination of B5H9 and 0 2. The two react according to the following balanced equation: 2B5H9(l)+12O2(g)5B2O3(s)+9H2O(g) If one tank in a rocket holds 126 g B5H9 and another tank holds 192 g O2, what mass of water can be produced when the entire contents of each tank react together?arrow_forwardConsider the following balanced chemical equation: A+5B3C+4D a. Equal masses of A and B are reacted. Complete each of the following with either A is the limiting reactant because ; B is the limiting reactant because ____ ; or we cannot determine the limiting reactant because _____ i. If the molar mass of A is greater than the molar mass of B, then ii. If the molar mass of B is greater than the molar mass of A, then b. The products of the reaction are carbon dioxide (C) and water (D). Compound A has a similar molar mass to carbon dioxide. Compound B is a diatomic molecule. Identify compound B, and support your answer. c. Compound A is a hydrocarbon that is 81.7 1% carbon by mass. Determine its empirical and molecular formulas.arrow_forwardou know that chemical A reacts with chemical B. You react 10.0 g A with 10.0 g B. What information do you need to know to determine the amount of product that will be produced? Explain.arrow_forward
- 4.30 Copper reacts with nitric acid via the following equation: 3Cu(s)+8HNO3(aq)3Cu( NO3)2(aq)+2NO(g)+4H2O(l) What mass of NO(g) can be formed when 10.0 g of Cu reacts with 115 g of HNO3?arrow_forwardSulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.arrow_forward3.105 Nitric acid is often sold and transported as a concentrated 16 M aqueous solution. How many gallons of such a solution would be needed to contain the roughly 2.1109 pounds of HNO3 produced annually in the United States?arrow_forward
arrow_back_ios
arrow_forward_ios
Recommended textbooks for you
- Chemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage LearningChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage Learning
- Introductory Chemistry: A FoundationChemistryISBN:9781337399425Author:Steven S. Zumdahl, Donald J. DeCostePublisher:Cengage LearningGeneral, Organic, and Biological ChemistryChemistryISBN:9781285853918Author:H. Stephen StokerPublisher:Cengage LearningChemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage Learning
Chemistry: An Atoms First Approach
Chemistry
ISBN:9781305079243
Author:Steven S. Zumdahl, Susan A. Zumdahl
Publisher:Cengage Learning
Chemistry
Chemistry
ISBN:9781305957404
Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste
Publisher:Cengage Learning
Introductory Chemistry: A Foundation
Chemistry
ISBN:9781337399425
Author:Steven S. Zumdahl, Donald J. DeCoste
Publisher:Cengage Learning
General, Organic, and Biological Chemistry
Chemistry
ISBN:9781285853918
Author:H. Stephen Stoker
Publisher:Cengage Learning
Chemistry for Engineering Students
Chemistry
ISBN:9781337398909
Author:Lawrence S. Brown, Tom Holme
Publisher:Cengage Learning
Bonding (Ionic, Covalent & Metallic) - GCSE Chemistry; Author: Science Shorts;https://www.youtube.com/watch?v=p9MA6Od-zBA;License: Standard YouTube License, CC-BY
Stoichiometry - Chemistry for Massive Creatures: Crash Course Chemistry #6; Author: Crash Course;https://www.youtube.com/watch?v=UL1jmJaUkaQ;License: Standard YouTube License, CC-BY