Concept explainers
(a)
Interpretation:
Enthalpy change for the given reaction should be calculated. The given reaction is,
Concept introduction:
Enthalpy
The value of standard enthalpy change
Where,
n is the number of moles.
(a)
Answer to Problem 5.82QE
Enthalpy change is
Explanation of Solution
The balanced equation for the given reaction follows as,
Standard enthalpy of formation values is given below,
Change in enthalpy can be calculated by the equation:
Substitute the values as follows,
(b)
Interpretation:
Enthalpy change for the given reaction should be calculated. The given reaction is,
Concept introduction:
Refer to (a).
(b)
Answer to Problem 5.82QE
Enthalpy change is
Explanation of Solution
The balanced equation for the given reaction follows as,
Standard enthalpy of formation values is given below,
Change in enthalpy can be calculated by the equation:
Substitute the values as follows,
(c)
Interpretation:
Enthalpy change for the given reaction should be calculated. The given reaction is,
Concept introduction:
Refer to (a).
(c)
Answer to Problem 5.82QE
Enthalpy change is
Explanation of Solution
The balanced equation for the given reaction follows as,
Standard enthalpy of formation values is given below,
Change in enthalpy can be calculated by the equation:
Substitute the values as follows,
Want to see more full solutions like this?
Chapter 5 Solutions
Chemistry Principles And Practice
- A 0.470-g sample of magnesium reacts with 200 g dilute HCl in a coffee-cup calorimeter to form MgCl2(aq) and H2(g). The temperature increases by 10.9 C as the magnesium reacts. Assume that the mixture has the same specific heat as water and a mass of 200 g. (a) Calculate the enthalpy change for the reaction. Is the process exothermic or endothermic? (b) Write the chemical equation and evaluate H.arrow_forwardThe enthalpy change for the following reaction is 393.5 kJ. C(s,graphite)+O2(g)CO2(g) (a) Is energy released from or absorbed by the system in this reaction? (b) What quantities of reactants and products are assumed? (c) Predict the enthalpy change observed when 3.00 g carbon burns in an excess of oxygen.arrow_forwardIs the following reaction the appropriate one to use in determining the enthalpy of formation of methane, CH4(g)? Why or why not? C(g)+4H(g)CH4(g)arrow_forward
- The Romans used calcium oxide, CaO, to produce a strong mortar to build stone structures. Calcium oxide was mixed with water to give Ca(OH)2, which reacted slowly with CO2 in the air to give CaCO3. Ca(OH)2(s) + CO2(g) CaCO3(s) + H2O(g) (a) Calculate the standard enthalpy change for this reaction. (b) How much energy is evolved or absorbed as heat if 1.00 kg of Ca(OH)2 reacts with a stoichiometric amount of CO2?arrow_forwardThe thermochemical equation for the burning of methane, the main component of natural gas, is CH4(g)+2O2(g)CO2(g)+2H2O(l)H=890kJ (a) Is this reaction endothermic or exothermic? (b) What quantities of reactants and products are assumed if H = 890 kJ? (c) What is the enthalpy change when 1.00 g methane burns in an excess of oxygen?arrow_forwardCompounds with carboncarbon double bonds, such as ethylene, C2H4, add hydrogen in a reaction called hydrogenation. C2H4(g)+H2(g)C2H6(g) Calculate the enthalpy change for this reaction, using the following combustion data: C2H4(g)+3O2(g)2CO2(g)+2H2O(l);H=1411kJC2H6(g)+72O2(g)2CO2(g)+3H2O(l);H=1560kJH2(g)+12O2(g)H2O(l);H=286kJarrow_forward
- What mass of acetylene, C2H2(g), must be burned to produce 3420 kJ of heat, given that its enthalpy of combustion is 1301 kJ/mol? Compare this with the answer to Exercise 5.91 and determine which substance produces more heat per gram.arrow_forward9.41 Under what conditions does the enthalpy change equal the heat of a process?arrow_forwardWhen 2.50 g of methane burns in oxygen, 125 kJ of heat is produced. What is the enthalpy of combustion per mole of methane under these conditions?arrow_forward
- Which of the enthalpies of combustion in Table 5.2 the table are also standard enthalpies of formation?arrow_forwardThe first step in the preparation of lead from its ore (galena, PbS) consists of roasting the ore. PbS(s)+32O2(g)SO2(g)+PbO(s) Calculate the standard enthalpy change for this reaction, using enthalpies of formation (see Appendix C).arrow_forward
- Chemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning
- Chemistry by OpenStax (2015-05-04)ChemistryISBN:9781938168390Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark BlaserPublisher:OpenStaxChemistry: Matter and ChangeChemistryISBN:9780078746376Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl WistromPublisher:Glencoe/McGraw-Hill School Pub CoChemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage Learning