A system at equilibrium contains 12 (g) at a pressure of 0.27 bar and I(g) at a pressure of 0.26 bar. The system is then compressed to third its volume. Find the pressure of I2 when the system returns to equilibrium. Express your answer to two significant figures and include the appropriate units. ▸ View Available Hint(s) ? P(12) 0.61 bar

A system at equilibrium contains 12 (g) at a pressure of 0.27 bar and I(g) at a pressure of 0.26 bar. The system is then compressed to third its volume. Find the pressure of I2 when the system returns to equilibrium. Express your answer to two significant figures and include the appropriate units. ▸ View Available Hint(s) ? P(12) 0.61 bar

Physical Chemistry

2nd Edition

ISBN:9781133958437

Author:Ball, David W. (david Warren), BAER, Tomas

Publisher:Ball, David W. (david Warren), BAER, Tomas

Chapter5: Introduction To Chemical Equilibrium

Section: Chapter Questions

Problem 5.41E: Write the equilibrium constant expression for each reaction in terms of activities, simplifying...

See similar textbooks

Similar questions

Indicate whether each statement below is true or false. If a statement is false, rewrite it to produce a closely related statement that is true. For a given reaction, the magnitude of the equilibrium constant is independent of temperature. If there is an increase in entropy and a decrease in enthalpy when reactants in their standard states are converted to products in their standard states, the equilibrium constant for the reaction must be negative. The equilibrium constant for the reverse of a reaction is the reciprocal of the equilibrium constant for the reaction itself. For the reaction H2O2(ℓ) ⇌ H2O(ℓ) + O2(g) the equilibrium constant is one half the magnitude of the equilibrium constant for the reaction 2H2O2(ℓ) ⇌ 2H2O(ℓ) + O2(g)
Methanol can be synthesized by means of the equilibriumreaction CO(g)+2H2(g)CH3OH(g) for which the equilibrium constant at 225°C is 6.08103. Assume that the ratio of the pressures of CO(g) and H2(g) is 1:2. What values should they have if the partial pressureof methanol is to be 0.500 atm?
5.12. True or false: If all the partial pressures of reactants and products drop by half, the value of Q drops by half. Give an example of a chemical reaction to support your answer.
For the given chemical equilibrium, these data are determined experimentally: T K 350K 3.76102 450K 1.86101 Determine H for this reaction.
At a certain temperature, K=0.29 for the decomposition of two moles of iodine trichloride, ICl3(s), to chlorine and iodine gases. The partial pressure of chlorine gas at equilibrium is three times that of iodine gas. What are the partial pressures of iodine and chlorine at equilibrium?
For the system 2SO3(g)2SO2(g)+O2(g) K=1.32 at 627. What is the equilibrium constant at 555C?
The equilibrium constant for the butane iso-butane equilibrium at 25 C is 2.50. Calculate rG at this temperature in units of kJ/mol.
The following equilibrium is established in a closed container: C(s)+O2(g)CO2(g)H=393kJmol1 How does the equilibrium shift in response to each of the following stresses? (a) The quantity of solid carbon is increased. (b) A small quantity of water is added, and CO2 dissolves in it. (c) The system is cooled. (d) The volume of the container is increased.
Predict the temperature at which the reaction in Exercise 17.67 comes to equilibrium. Consider the equation G = H TS. At some value of T, G equals zero and the reaction is at equilibrium. Set G = 0, substitute for H and S (assuming that they do not vary much with temperature) and solve for T. CH3CHO(l)+52O2(g)2CO2(g)+2H2O(l)
Consider an equilibrium mixture of four chemicals (A, B, C, and D, all gases) reacting in a closed flask according to the equation: A(g)+B(g)C(g)+D(g) a. You add more A to the flask. How does the concentration of each chemical compare to its original concentration after equilibrium is reestablished? Justify your answer. b. You have the original setup at equilibrium, and you add more D to the flask. How does the concentration of each chemical compare to its original concentration after equilibrium is reestablished? Justify your answer.
For the system SO3(g)SO2(g)+12 O2(g)at 1000 K, K=0.45. Sulfur trioxide, originally at 1.00 atm pressure, partially dissociates to SO2 and O2 at 1000 K. What is its partial pressure at equilibrium?
5.2. What is the difference between a static equilibrium and a dynamic equilibrium? Give examples difference from the examples in the text. What is similar for the two types of equilibria?