Concept explainers
Interpretation:
Whether tert-butoxide ion is a base, strong enough to react significantly with water or can a solution of ter-butoxide prepared in water is to be decided. pKa of tert-butyl alcohol is given as approximately 18.
Concept introduction:
Water can act as an acid or as a base. It can donate H+ to substances which are weaker acids (with higher pKa value than that of water) than water. It can accept H+ from substances which are stronger acids (with lower pKa value than that of water).
To determine:
Whether tert-butoxide ion is a base, strong enough to react significantly with water or can a solution of ter-butoxide prepared in water. pKa of tert-butyl alcohol is given as approximately 18.
Trending nowThis is a popular solution!
Chapter 2 Solutions
Organic Chemistry
- Several diamines are building blocks for the synthesis of pharmaceuticals and agro-chemicals. Show how both 1,3-propanediamine and 1,4-butanediamine can be prepared from acrylonitrile.arrow_forwardComplete each acid-base reaction and predict whether the position of equilibrium lies toward the left or toward the right. (a) CH3CCH+CH3CH2ONa+CH3CH3OH (b) CH3CCCH2CH2OH+Na+NH2NH3(l)arrow_forwardRank the following substances in order of increasing acidity: (a) (CH3)2CHOH, HC≡CH, (CF3)2CHOH, CH3OH (b) Phenol, p-methylphenol, p-[trifluoromethyl) phenol (c) Benzyl alcohol, phenol, p-hydroxybenzonic acidarrow_forward
- Account for the fact that treating propenoic acid (acrylic acid) with HCl gives only 3-chloropropanoic acid.arrow_forward16-17 Propylamine (bp 48°C), ethylmethylamine (bp 37°C), and trimethylamine (bp 3°C) are constitutional isomers with the molecular formula C3HgN. Account for the fact that trimethylamine has the lowest boiling point of the three and propylamine has the highest.arrow_forwardPQ-16. What is the major product of this reaction? OH (A) (B) 2) H3O+ H (C) (D) Harrow_forward
- Why does a substance become more soluble in a solvent with increasing temperature? Solvents are ordered by decreasing value of theirdielectric constant. In the table, which is the most polar solvent and which is the least polar? How can acetylsalicylic acid be obtained from salicylic acid?arrow_forwardGiven that pKa for phenol is 9.95 and pKą for the ammonium ion is 9.24, will the following reaction be favorable? (Will the products be favored at equilibrium?) OH + NH3 phenol pKa = 9.95 ammonia phenoxide ion ammonium ion pKa = 9.24arrow_forwardPQ-27. What is the product of this reaction? (A) 0 OH a (B) (D) H₂ Ptarrow_forward
- Acetals are formed from the reaction of two alcohols with a carbonyl under acidic conditions. Acetal formation is faster with 1,2-ethanediol than with two methanol molecules. Choose the factor that explains the difference in reaction rates. A) The reaction with 1,2-ethanediol has a lower AH (enthalpy) of reaction. B) The reaction with 1,2-ethanediol has a higher AH (enthalpy) of reaction. C) The reaction with 1,2-ethanediol has a more favorable entropy of reaction.arrow_forward4-Methylphenol is more acidic than ethanol (pKa 10.36 vs 16.0) , even though both contain an OH group and a methyl group. Draw the structures of the anions formed from loss of the alcoholic protons from both compounds. Use resonance to explain the difference in their respective acidities.arrow_forwardWrite an equation for the acid-base reaction between ethylmagnesium iodide and an alcohol. Use curved arrows to show the flow of electrons in this reaction. In addition, show by using appropriate pKa values that this reaction is an example of a stronger acid and stronger base reacting to give a weaker acid and weaker base.arrow_forward
- Organic ChemistryChemistryISBN:9781305580350Author:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. FootePublisher:Cengage LearningIntroduction to General, Organic and BiochemistryChemistryISBN:9781285869759Author:Frederick A. Bettelheim, William H. Brown, Mary K. Campbell, Shawn O. Farrell, Omar TorresPublisher:Cengage LearningChemistry for Today: General, Organic, and Bioche...ChemistryISBN:9781305960060Author:Spencer L. Seager, Michael R. Slabaugh, Maren S. HansenPublisher:Cengage Learning
- Organic Chemistry: A Guided InquiryChemistryISBN:9780618974122Author:Andrei StraumanisPublisher:Cengage Learning